Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 06:04:08 UTC
Update Date2025-10-07 16:06:22 UTC
Metabolite IDMMDBc0015199
Metabolite Identification
Common NamePhycomysterol B
DescriptionPhycomysterol B is a sterol, a class of organic compounds characterized by a multi-ring structure that includes a hydroxyl group. This metabolite has been identified in various studies focusing on its chemical properties and potential biological activities. The structures of phycomysterol B, along with phycomysterol A and neoergosterol, were confirmed through chemical synthesis, highlighting the importance of synthetic methods in understanding these compounds (PMID:9868149 ). While the primary focus has been on its chemical characterization, phycomysterol B may also exhibit biological significance, similar to other sterols, which are known to play crucial roles in cellular membrane structure and function. Further research into phycomysterol B could elucidate its specific biological activities and potential applications in medicine or biotechnology.
Structure
SynonymsNot Available
Molecular FormulaC27H42O
Average Mass382.632
Monoisotopic Mass382.323565972
IUPAC Name(5S,11R,15R)-14-[(2R,5S)-5,6-dimethylheptan-2-yl]-15-methyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadeca-1(10),2(7),8-trien-5-ol
Traditional Name(5S,11R,15R)-14-[(2R,5S)-5,6-dimethylheptan-2-yl]-15-methyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadeca-1(10),2(7),8-trien-5-ol
CAS Registry NumberNot Available
SMILES
[H][C@](C)(CC[C@@]([H])(C)C1([H])CC[C@@]2([H])C3=C(CC[C@]12C)C1=C(C[C@@]([H])(O)CC1)C=C3)C(C)C
InChI Identifier
InChI=1S/C27H42O/c1-17(2)18(3)6-7-19(4)25-12-13-26-24-10-8-20-16-21(28)9-11-22(20)23(24)14-15-27(25,26)5/h8,10,17-19,21,25-26,28H,6-7,9,11-16H2,1-5H3/t18-,19+,21-,25?,26-,27+/m0/s1
InChI KeyFYGDBMTUASHJML-QSZDRVGQSA-N