Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 06:09:43 UTC
Update Date2025-10-07 16:06:24 UTC
Metabolite IDMMDBc0015305
Metabolite Identification
Common NamePseudomycin C
DescriptionPseudomycin C is a cyclic depsinonapeptide, a chemical class characterized by a cyclic structure composed of amino acids linked by ester bonds. This metabolite is derived from the fermentation processes of certain microorganisms and has garnered attention for its potential therapeutic applications. Research has demonstrated the synthesis of pseudomycin C through novel methods, including acid-promoted side-chain deacylation of pseudomycin A, highlighting its structural complexity and the innovative approaches required for its production (PMID:11206449 ). Additionally, studies have focused on the synthesis of prodrugs of pseudomycin C and related compounds to enhance their therapeutic indexes (PMID:11472220 ). The chemical structure of pseudomycin C is further defined by its acylation patterns, which involve specific fatty acid derivatives, such as 3,4-dihydroxyhexadecanoate (PMID:7957970 ). This unique acylation contributes to the biological activity of pseudomycin C, making it a compound of interest in the development of new antimicrobial agents. Overall, the chemistry of pseudomycin C underscores its significance in medicinal chemistry and its potential role in addressing antibiotic resistance.
Structure
Synonyms
ValueSource
2-[(9E)-18-(4-Aminobutyl)-15,24-bis(2-aminoethyl)-21-(carboxymethyl)-3-(2-chloro-1-hydroxyethyl)-9-ethylidene-5,8,11,14,17,20,23,26-octahydroxy-12-(1-hydroxyethyl)-2-oxo-27-[(1,3,4-trihydroxyhexadecylidene)amino]-1-oxa-4,7,10,13,16,19,22,25-octaazacyclooctacosa-4,7,10,13,16,19,22,25-octaen-6-yl]-2-hydroxyacetateGenerator
Molecular FormulaC53H91ClN12O20
Average Mass1251.83
Monoisotopic Mass1250.6161111
IUPAC Name2-[(9E)-18-(4-aminobutyl)-15,24-bis(2-aminoethyl)-21-(carboxymethyl)-3-(2-chloro-1-hydroxyethyl)-9-ethylidene-5,8,11,14,17,20,23,26-octahydroxy-12-(1-hydroxyethyl)-2-oxo-27-[(1,3,4-trihydroxyhexadecylidene)amino]-1-oxa-4,7,10,13,16,19,22,25-octaazacyclooctacosa-4,7,10,13,16,19,22,25-octaen-6-yl]-2-hydroxyacetic acid
Traditional Name[(9E)-18-(4-aminobutyl)-15,24-bis(2-aminoethyl)-21-(carboxymethyl)-3-(2-chloro-1-hydroxyethyl)-9-ethylidene-5,8,11,14,17,20,23,26-octahydroxy-12-(1-hydroxyethyl)-2-oxo-27-[(1,3,4-trihydroxyhexadecylidene)amino]-1-oxa-4,7,10,13,16,19,22,25-octaazacyclooctacosa-4,7,10,13,16,19,22,25-octaen-6-yl](hydroxy)acetic acid
CAS Registry NumberNot Available
SMILES
[H]\C(C)=C1/N=C(O)C(N=C(O)C(CCN)N=C(O)C(CCCCN)N=C(O)C(CC(O)=O)N=C(O)C(CCN)N=C(O)C(COC(=O)C(N=C(O)C(N=C1O)C(O)C(O)=O)C(O)CCl)N=C(O)CC(O)C(O)CCCCCCCCCCCC)C(C)O
InChI Identifier
InChI=1S/C53H91ClN12O20/c1-4-6-7-8-9-10-11-12-13-14-18-35(68)36(69)25-38(71)58-34-27-86-53(85)41(37(70)26-54)65-51(82)42(43(74)52(83)84)66-44(75)29(5-2)59-50(81)40(28(3)67)64-47(78)32(20-23-57)61-45(76)30(17-15-16-21-55)60-48(79)33(24-39(72)73)63-46(77)31(19-22-56)62-49(34)80/h5,28,30-37,40-43,67-70,74H,4,6-27,55-57H2,1-3H3,(H,58,71)(H,59,81)(H,60,79)(H,61,76)(H,62,80)(H,63,77)(H,64,78)(H,65,82)(H,66,75)(H,72,73)(H,83,84)/b29-5+
InChI KeyAWTIXUKUGKVRHD-IMUCOVGGSA-N