Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 06:11:53 UTC
Update Date2025-10-07 16:06:24 UTC
Metabolite IDMMDBc0015357
Metabolite Identification
Common NameVersicotide A
DescriptionVersicotide A is a secondary metabolite belonging to the class of polyketides. This compound has garnered attention in the field of organic chemistry due to its structural complexity and potential biological activities. Recent research has successfully achieved the first total synthesis of versicotide A, along with its analogs versicotide B and C, demonstrating the feasibility of producing these compounds in a laboratory setting (PMID:35519702 ). The synthesis of versicotide A not only provides insights into its chemical properties but also paves the way for further exploration of its biological functions. Polyketides, like versicotide A, are known for their diverse range of bioactivities, including antimicrobial and anticancer properties, making them valuable targets for drug discovery. Understanding the chemical structure and synthesis pathways of versicotide A could lead to the development of novel therapeutic agents. As research progresses, the biological implications of versicotide A and its derivatives will likely be elucidated, enhancing our understanding of their role in natural product chemistry and potential applications in medicine.
Structure
SynonymsNot Available
Molecular FormulaC25H29N5O5
Average Mass479.537
Monoisotopic Mass479.216869054
IUPAC Name(4S,15S,18S)-3,14,20-trihydroxy-4,5,15,16,18-pentamethyl-2,5,13,16,19-pentaazatricyclo[19.4.0.0^{7,12}]pentacosa-1(25),2,7,9,11,13,19,21,23-nonaene-6,17-dione
Traditional Name(4S,15S,18S)-3,14,20-trihydroxy-4,5,15,16,18-pentamethyl-2,5,13,16,19-pentaazatricyclo[19.4.0.0^{7,12}]pentacosa-1(25),2,7,9,11,13,19,21,23-nonaene-6,17-dione
CAS Registry NumberNot Available
SMILES
[H][C@@]1(C)N=C(O)C2=CC=CC=C2N=C(O)[C@]([H])(C)N(C)C(=O)C2=CC=CC=C2N=C(O)[C@]([H])(C)N(C)C1=O
InChI Identifier
InChI=1S/C25H29N5O5/c1-14-24(34)29(4)15(2)21(31)28-20-13-9-7-11-18(20)25(35)30(5)16(3)22(32)27-19-12-8-6-10-17(19)23(33)26-14/h6-16H,1-5H3,(H,26,33)(H,27,32)(H,28,31)/t14-,15-,16-/m0/s1
InChI KeySRHCZSHNDDEHKH-JYJNAYRXSA-N