Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 06:45:54 UTC
Update Date2025-10-07 16:06:29 UTC
Metabolite IDMMDBc0016036
Metabolite Identification
Common NameBicoumanigrin
DescriptionBicoumanigrin is a 3,3'-bicoumarin, belonging to the class of coumarin derivatives. Its chemical structure features two coumarin units linked by a carbon-carbon bond, which contributes to its unique properties. Bicoumanigrin is involved in various biochemical pathways, particularly in the biosynthesis of secondary metabolites, where it is associated with the enhanced production of naphtho-γ-pyrones and other therapeutically relevant small molecules (SMs) such as aurasperones and pyranonigrin A (PMID:32670208 ). Additionally, it has been identified alongside structurally unusual compounds like aspernigrins and pyranonigrins, indicating its potential role in the diverse chemistry of fungal metabolites (PMID:15387655 ). Notably, bicoumanigrin has demonstrated moderate cytotoxicity against human cancer cell lines in vitro, suggesting its relevance in cancer research and potential therapeutic applications (PMID:15387655 ). Overall, bicoumanigrin represents a significant compound within the realm of natural products, showcasing the intricate interplay between chemical structure and biological activity.
Structure
Synonyms
ValueSource
33'-Bicoumarin bicoumanigrinChEMBL
Molecular FormulaC22H18O8
Average Mass410.378
Monoisotopic Mass410.10016754
IUPAC Name3-(4,7-dihydroxy-5-methyl-2-oxo-2H-chromen-3-yl)-4,7-dimethoxy-5-methyl-2H-chromen-2-one
Traditional Name3-(4,7-dihydroxy-5-methyl-2-oxochromen-3-yl)-4,7-dimethoxy-5-methylchromen-2-one
CAS Registry NumberNot Available
SMILES
COC1=CC(C)=C2C(OC(=O)C(=C2OC)C2=C(O)C3=C(C)C=C(O)C=C3OC2=O)=C1
InChI Identifier
InChI=1S/C22H18O8/c1-9-5-11(23)7-13-15(9)19(24)17(21(25)29-13)18-20(28-4)16-10(2)6-12(27-3)8-14(16)30-22(18)26/h5-8,23-24H,1-4H3
InChI KeyLESVQQSUHUNTRC-UHFFFAOYSA-N