Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 06:48:48 UTC
Update Date2025-10-07 16:06:30 UTC
Metabolite IDMMDBc0016100
Metabolite Identification
Common NameLynamicin A
DescriptionLynamicin A is a member of the chemical class of metabolites known as spiroindimicins, which are characterized by their unique spirocyclic structure. The compound is derived from deep marine sea-derived Streptomyces sp. and exhibits a complex chemical architecture that contributes to its biological activity. In silico molecular docking studies have been employed to explore the interactions of lynamicin A with various drug target enzymes, highlighting its potential as a lead compound for further pharmacological development. The preclinical evaluation of lynamicin A, alongside related compounds such as spiroindimicins A-D, indicates its involvement in specific biochemical pathways that may be relevant for therapeutic applications (PMID:25205496 ). This research underscores the importance of marine-derived natural products in drug discovery and the potential for lynamicin A to interact with key biological targets, paving the way for future studies aimed at elucidating its mechanisms of action and therapeutic potential (PMID:25205496 ).
Structure
Synonyms
ValueSource
Methyl 3,4-bis(5-chloro-1H-indol-3-yl)-1H-pyrrole-2-carboxylic acidGenerator
Molecular FormulaC22H15Cl2N3O2
Average Mass424.28
Monoisotopic Mass423.0541321
IUPAC Namemethyl 3,4-bis(5-chloro-1H-indol-3-yl)-1H-pyrrole-2-carboxylate
Traditional Namelynamicin A
CAS Registry NumberNot Available
SMILES
COC(=O)C1=C(C(=CN1)C1=CNC2=CC=C(Cl)C=C12)C1=CNC2=CC=C(Cl)C=C12
InChI Identifier
InChI=1S/C22H15Cl2N3O2/c1-29-22(28)21-20(16-9-26-19-5-3-12(24)7-14(16)19)17(10-27-21)15-8-25-18-4-2-11(23)6-13(15)18/h2-10,25-27H,1H3
InChI KeyADBVWUJBUGOHJH-UHFFFAOYSA-N