Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 06:53:22 UTC
Update Date2025-10-07 16:06:31 UTC
Metabolite IDMMDBc0016207
Metabolite Identification
Common NameIsochaetominine
DescriptionIsochaetominine is a meroditerpene pyrone, a chemical class characterized by a combination of terpenoid and pyrone structures. Its chemical structure features a unique tetracyclic core framework that is related to the fumiquinazolines, which is indicative of its complex biosynthetic origin. Isochaetominine is produced by the endophytic fungus Aspergillus fumigatus, which has been shown to yield this compound alongside other metabolites such as asperfumigatin and various isochaetominine analogs (PMID:26363876 ). The biosynthetic pathways involved in the formation of isochaetominine and its derivatives likely include polyketide and amino acid metabolism, reflecting the intricate interplay of fungal secondary metabolism. Additionally, isochaetominines A-C and 14-epi-isochaetominine C, which possess similar structural features, have been isolated from the same fungal strain, further highlighting the chemical diversity and potential biosynthetic routes associated with isochaetominine (PMID:25581396 ). This compound exemplifies the rich chemical arsenal of secondary metabolites produced by fungi, which can have implications in various biological contexts.
Structure
SynonymsNot Available
Molecular FormulaC22H18N4O4
Average Mass402.41
Monoisotopic Mass402.132805076
IUPAC Name(1S,10S,13S,15S)-1-hydroxy-10-methyl-13-(4-oxo-3,4-dihydroquinazolin-3-yl)-8,11-diazatetracyclo[6.6.1.0^{2,7}.0^{11,15}]pentadeca-2,4,6-triene-9,12-dione
Traditional Name(1S,10S,13S,15S)-1-hydroxy-10-methyl-13-(4-oxoquinazolin-3-yl)-8,11-diazatetracyclo[6.6.1.0^{2,7}.0^{11,15}]pentadeca-2,4,6-triene-9,12-dione
CAS Registry NumberNot Available
SMILES
[H][C@@]1(C)N2C(=O)[C@]([H])(C[C@]3(O)C4=CC=CC=C4N(C1=O)[C@]23[H])N1C=NC2=CC=CC=C2C1=O
InChI Identifier
InChI=1S/C22H18N4O4/c1-12-18(27)26-16-9-5-3-7-14(16)22(30)10-17(20(29)25(12)21(22)26)24-11-23-15-8-4-2-6-13(15)19(24)28/h2-9,11-12,17,21,30H,10H2,1H3/t12-,17-,21-,22-/m0/s1
InChI KeyGEURDGODABUDHB-DLRNMSQQSA-N