Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 06:54:25 UTC
Update Date2025-10-07 16:06:31 UTC
Metabolite IDMMDBc0016230
Metabolite Identification
Common NameErgosterimide
DescriptionErgosterimide is a natural product belonging to the chemical class of sterols and is characterized as a Diels-Alder adduct formed from an ergosteroid and maleimide. Its chemical structure features a steroid backbone typical of ergosterol derivatives, which contributes to its unique reactivity and biological properties. Ergosterimide has been isolated from the fermentation culture of the fungus Aspergillus tubingensis YP-2, alongside other sterol derivatives (PMID:31790288 ). Additionally, it has been characterized from the culture extract of Aspergillus niger EN-13, an endophytic fungus sourced from the marine brown alga Colpomenia sinuosa (PMID:17628622 ). In terms of biochemical pathways, ergosterimide may play a role in the metabolic processes of fungi, particularly in the biosynthesis of sterols, which are vital for maintaining cell membrane integrity and fluidity. Its unique structure and formation through Diels-Alder reactions suggest potential interactions with various biological targets, although the specific pathways involving ergosterimide remain to be fully elucidated.
Structure
SynonymsNot Available
Molecular FormulaC32H45NO3
Average Mass491.716
Monoisotopic Mass491.339944313
IUPAC Name(1S,5S,8R,12R,15R,16R,20S)-13-[(2R,3E,5R)-5,6-dimethylhept-3-en-2-yl]-5,19-dihydroxy-8,12-dimethyl-18-azahexacyclo[10.8.2.0^{3,8}.0^{9,21}.0^{15,22}.0^{16,20}]docosa-2,18,21-trien-17-one
Traditional Name(1S,5S,8R,12R,15R,16R,20S)-13-[(2R,3E,5R)-5,6-dimethylhept-3-en-2-yl]-5,19-dihydroxy-8,12-dimethyl-18-azahexacyclo[10.8.2.0^{3,8}.0^{9,21}.0^{15,22}.0^{16,20}]docosa-2,18,21-trien-17-one
CAS Registry NumberNot Available
SMILES
[H]\C(=C(\[H])[C@@]([H])(C)C1([H])C[C@@]2([H])C3=C4[C@@]([H])(C=C5C[C@@]([H])(O)CC[C@]5(C)C4([H])CC[C@]13C)[C@]1([H])C(O)=NC(=O)[C@]21[H])[C@]([H])(C)C(C)C
InChI Identifier
InChI=1S/C32H45NO3/c1-16(2)17(3)7-8-18(4)24-15-22-27-26(29(35)33-30(27)36)21-14-19-13-20(34)9-11-31(19,5)23-10-12-32(24,6)28(22)25(21)23/h7-8,14,16-18,20-24,26-27,34H,9-13,15H2,1-6H3,(H,33,35,36)/b8-7+/t17-,18+,20-,21+,22+,23?,24?,26-,27+,31-,32+/m0/s1
InChI KeyUVJQWIZGFAYGJK-YJNQILDBSA-N