Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 06:58:41 UTC
Update Date2025-10-07 16:06:32 UTC
Metabolite IDMMDBc0016304
Metabolite Identification
Common Name9-deacetylfumigaclavine C
Description9-deacetylfumigaclavine C is a secondary metabolite belonging to the class of alkaloids. It is structurally characterized by the presence of a fumigaclavine backbone, which is a complex polycyclic structure featuring multiple rings and nitrogen atoms. This compound was isolated from the culture of Aspergillus fumigatus, a well-known fungus that produces various bioactive metabolites (PMID:19256529 ). In terms of biochemical pathways, 9-deacetylfumigaclavine C is involved in the biosynthesis of other fumigaclavine derivatives and may play a role in the organism's secondary metabolism. Alkaloids like 9-deacetylfumigaclavine C are often implicated in various biological activities, including potential antimicrobial and cytotoxic effects, although specific biological significance is not the focus here. The unique structural features of 9-deacetylfumigaclavine C contribute to its chemical reactivity and potential interactions within biological systems, making it a compound of interest in both natural product chemistry and pharmacology.
Structure
SynonymsNot Available
Molecular FormulaC21H28N2O
Average Mass324.468
Monoisotopic Mass324.22016353
IUPAC Name(2R,3S,4S,7R)-4,6-dimethyl-10-(2-methylbut-3-en-2-yl)-6,11-diazatetracyclo[7.6.1.0^{2,7}.0^{12,16}]hexadeca-1(16),9,12,14-tetraen-3-ol
Traditional Name(2R,3S,4S,7R)-4,6-dimethyl-10-(2-methylbut-3-en-2-yl)-6,11-diazatetracyclo[7.6.1.0^{2,7}.0^{12,16}]hexadeca-1(16),9,12,14-tetraen-3-ol
CAS Registry NumberNot Available
SMILES
[H][C@]1(C)CN(C)[C@]2([H])CC3=C(NC4=CC=CC(=C34)[C@@]2([H])[C@@]1([H])O)C(C)(C)C=C
InChI Identifier
InChI=1S/C21H28N2O/c1-6-21(3,4)20-14-10-16-18(19(24)12(2)11-23(16)5)13-8-7-9-15(22-20)17(13)14/h6-9,12,16,18-19,22,24H,1,10-11H2,2-5H3/t12-,16+,18+,19-/m0/s1
InChI KeyVCXCXXJJHZVDSD-GJGHSUIPSA-N