Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 07:14:58 UTC
Update Date2025-10-07 16:06:35 UTC
Metabolite IDMMDBc0016648
Metabolite Identification
Common NameChaetoglobinol A
DescriptionChaetoglobinol A is a secondary metabolite belonging to the chemical class of indole alkaloids. It was isolated from the rice culture of the fungus Chaetomium globosum, alongside other compounds such as chaetocochin J, chetomin, and cochliodinol (PMID:26125976 ). The chemical structure of Chaetoglobinol A features a complex arrangement of carbon, nitrogen, and oxygen atoms characteristic of indole alkaloids, which often exhibit diverse biological activities. In terms of biochemical pathways, Chaetoglobinol A may be involved in various metabolic processes within the fungal organism, potentially influencing secondary metabolite production and contributing to the organism's ecological interactions. Its structural features suggest potential roles in cellular signaling or defense mechanisms, although specific biological functions require further investigation. The study of such metabolites is crucial for understanding the chemical ecology of fungi and their potential applications in pharmaceuticals and agriculture.
Structure
SynonymsNot Available
Molecular FormulaC32H30N2O5
Average Mass522.601
Monoisotopic Mass522.215472074
IUPAC Name3,5-dihydroxy-3,6-bis[5-(3-methylbut-2-en-1-yl)-1H-indol-3-yl]cyclohex-5-ene-1,2,4-trione
Traditional Name3,5-dihydroxy-3,6-bis[5-(3-methylbut-2-en-1-yl)-1H-indol-3-yl]cyclohex-5-ene-1,2,4-trione
CAS Registry NumberNot Available
SMILES
CC(C)=CCC1=CC2=C(NC=C2C2=C(O)C(=O)C(O)(C3=CNC4=C3C=C(CC=C(C)C)C=C4)C(=O)C2=O)C=C1
InChI Identifier
InChI=1S/C32H30N2O5/c1-17(2)5-7-19-9-11-25-21(13-19)23(15-33-25)27-28(35)30(37)32(39,31(38)29(27)36)24-16-34-26-12-10-20(14-22(24)26)8-6-18(3)4/h5-6,9-16,33-35,39H,7-8H2,1-4H3
InChI KeyQOAPGRJTTCYFMV-UHFFFAOYSA-N