Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 07:21:51 UTC
Update Date2025-10-07 16:06:35 UTC
Metabolite IDMMDBc0016819
Metabolite Identification
Common Name2-decaprenylphenol
Description2-decaprenylphenol is a polyisoprenoid phenol, classified within the chemical class of phenolic compounds. It is characterized by a long hydrophobic decaprenyl side chain attached to a phenolic ring, which contributes to its unique chemical properties. This compound plays a crucial role in the biosynthesis of ubiquinone-10 (coenzyme Q10), a vital component of the electron transport chain in cellular respiration. The biosynthetic pathway involves the conversion of 2-decaprenylphenol to ubiquinone-10 through a series of enzymatic reactions, highlighting its importance in energy metabolism and mitochondrial function. The presence of 2-decaprenylphenol is essential for the proper functioning of various biological processes, as ubiquinone-10 is involved in ATP production and acts as an antioxidant. Its role as a biosynthetic precursor underscores the intricate connections between metabolic pathways and the synthesis of essential biomolecules. Understanding the chemistry and pathways involving 2-decaprenylphenol can provide insights into its significance in cellular physiology and potential implications in health and disease (PMID:14292977 ).
Structure
SynonymsNot Available
Molecular FormulaC56H86O
Average Mass775.303
Monoisotopic Mass774.667867389
IUPAC Name2-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaen-1-yl]phenol
Traditional Name2-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaen-1-yl]phenol
CAS Registry NumberNot Available
SMILES
[H]\C(CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC1=CC=CC=C1O)=C(\C)CCC=C(C)C
InChI Identifier
InChI=1S/C56H86O/c1-45(2)23-14-24-46(3)25-15-26-47(4)27-16-28-48(5)29-17-30-49(6)31-18-32-50(7)33-19-34-51(8)35-20-36-52(9)37-21-38-53(10)39-22-40-54(11)43-44-55-41-12-13-42-56(55)57/h12-13,23,25,27,29,31,33,35,37,39,41-43,57H,14-22,24,26,28,30,32,34,36,38,40,44H2,1-11H3/b46-25+,47-27+,48-29+,49-31+,50-33+,51-35+,52-37+,53-39+,54-43+
InChI KeyITHUBQNZOUHCMG-GBBROCKZSA-N