Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 07:25:51 UTC
Update Date2025-10-07 16:06:36 UTC
Metabolite IDMMDBc0016915
Metabolite Identification
Common NameCJ-15,183
DescriptionCJ-15,183 is a squalene synthase inhibitor belonging to the class of organic compounds known as terpenoids. Its chemical structure features a unique arrangement of carbon atoms that allows it to effectively inhibit the enzyme squalene synthase, which plays a critical role in the biosynthetic pathway of sterols and triterpenes. This inhibition can disrupt the synthesis of squalene, a key precursor in the production of cholesterol and other important biomolecules. CJ-15,183 was isolated from the fermentation broth of the fungus Aspergillus aculeatus, highlighting the potential of fungal metabolites in drug discovery. The compound's mechanism of action involves targeting the squalene synthase enzyme, thereby influencing lipid metabolism and potentially impacting various biological pathways related to cholesterol homeostasis and membrane integrity. The identification of CJ-15,183 as a novel squalene synthase inhibitor underscores its relevance in the study of metabolic pathways and its potential therapeutic applications. (PMID:11827032 )
Structure
SynonymsNot Available
Molecular FormulaC28H38O13
Average Mass582.599
Monoisotopic Mass582.231241284
IUPAC Name1-[(3-carboxy-2-hydroxy-2-{2-oxo-5-[(1E,5Z,8Z)-tetradeca-1,5,8-trien-1-yl]oxolan-3-yl}propanoyl)oxy]propane-1,2,3-tricarboxylic acid
Traditional Name1-[(3-carboxy-2-hydroxy-2-{2-oxo-5-[(1E,5Z,8Z)-tetradeca-1,5,8-trien-1-yl]oxolan-3-yl}propanoyl)oxy]propane-1,2,3-tricarboxylic acid
CAS Registry NumberNot Available
SMILES
[H]\C(CCCCC)=C(/[H])C\C([H])=C(\[H])CC\C([H])=C(/[H])C1CC(C(=O)O1)C(O)(CC(O)=O)C(=O)OC(C(CC(O)=O)C(O)=O)C(O)=O
InChI Identifier
InChI=1S/C28H38O13/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18-15-20(26(37)40-18)28(39,17-22(31)32)27(38)41-23(25(35)36)19(24(33)34)16-21(29)30/h6-7,9-10,13-14,18-20,23,39H,2-5,8,11-12,15-17H2,1H3,(H,29,30)(H,31,32)(H,33,34)(H,35,36)/b7-6-,10-9-,14-13+
InChI KeySCNKZRBYVALSHS-OXXZWVFOSA-N