Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 07:30:47 UTC
Update Date2025-10-07 16:06:37 UTC
Metabolite IDMMDBc0017028
Metabolite Identification
Common NameSperabillin A
DescriptionSperabillin A is a peptidyl polymer antibiotic belonging to the chemical class of pseudo-peptides. Its chemical structure is characterized by the formula 3-[[[3R,5R)-3-amino-6-[(2E,4Z)-2,4-hexadienoylamino]-5-hydroxyhexanoyl]amino]propanamidine dihydrochloride, which highlights its complex arrangement of amino acids and functional groups. This compound has been shown to undergo polymerization under humid conditions or in the presence of radical initiators, leading to the formation of sperabillin polymers that exhibit notable antitumor activity (PMID:8150557 ). Additionally, derivatives of sperabillin A, such as those synthesized from dehexadienoylsperabillin A and (E,E)-muconic acid, have demonstrated enhanced protective effects against Gram-negative bacteria compared to the parent compound (PMID:8514635 ). In terms of biological activity, sperabillin A has been reported to inhibit vital biosynthetic pathways in Escherichia coli, including DNA, RNA, protein, and cell wall synthesis, indicating its potential as an antimicrobial agent (PMID:1372306 ). Overall, sperabillin A represents a significant compound within the realm of antibiotic research, with a complex chemical structure and diverse biological implications.
Structure
SynonymsNot Available
Molecular FormulaC15H27N5O3
Average Mass325.413
Monoisotopic Mass325.211389749
IUPAC Name(2E,4Z)-N-[(2R,4R)-4-amino-5-[(2-carbamimidoylethyl)-C-hydroxycarbonimidoyl]-2-hydroxypentyl]hexa-2,4-dienimidic acid
Traditional Name(2E,4Z)-N-[(2R,4R)-4-amino-5-[(2-carbamimidoylethyl)-C-hydroxycarbonimidoyl]-2-hydroxypentyl]hexa-2,4-dienimidic acid
CAS Registry NumberNot Available
SMILES
[H]\C(C)=C(/[H])\C(\[H])=C(/[H])C(O)=NC[C@]([H])(O)C[C@@]([H])(N)CC(O)=NCCC(N)=N
InChI Identifier
InChI=1S/C15H27N5O3/c1-2-3-4-5-14(22)20-10-12(21)8-11(16)9-15(23)19-7-6-13(17)18/h2-5,11-12,21H,6-10,16H2,1H3,(H3,17,18)(H,19,23)(H,20,22)/b3-2-,5-4+/t11-,12-/m1/s1
InChI KeyOAXPQNCOMDEHMJ-FHNIRRRCSA-N