Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 07:48:58 UTC
Update Date2025-10-07 16:06:41 UTC
Metabolite IDMMDBc0017430
Metabolite Identification
Common NameHatomarubigin F
DescriptionHatomarubigin F is a secondary metabolite classified within the polyketide chemical class. Its chemical structure features a complex arrangement of carbon chains and functional groups characteristic of polyketides, which are synthesized through the action of polyketide synthases. Hatomarubigin F is produced by the actinobacterium Streptomyces lividans, specifically in a genetic context where the hrb genes are expressed, although the hrbF gene is absent (PMID:24129687 ). This compound is involved in various biosynthetic pathways, contributing to the organism's metabolic diversity. Polyketides like hatomarubigin F often play roles in ecological interactions, such as antimicrobial activity, though the precise biological pathways in which hatomarubigin F participates remain to be fully elucidated. The study of such metabolites can provide insights into the genetic and enzymatic mechanisms underlying their biosynthesis, as well as their potential applications in biotechnology and medicine.
Structure
SynonymsNot Available
Molecular FormulaC19H16O6
Average Mass340.331
Monoisotopic Mass340.094688235
IUPAC Name1,5,8,11-tetrahydroxy-3-methyl-1,2,3,4,7,12-hexahydrotetraphene-7,12-dione
Traditional Name1,5,8,11-tetrahydroxy-3-methyl-1,2,3,4-tetrahydrotetraphene-7,12-dione
CAS Registry NumberNot Available
SMILES
CC1CC(O)C2=C3C(=O)C4=C(O)C=CC(O)=C4C(=O)C3=CC(O)=C2C1
InChI Identifier
InChI=1S/C19H16O6/c1-7-4-8-12(22)6-9-15(14(8)13(23)5-7)19(25)17-11(21)3-2-10(20)16(17)18(9)24/h2-3,6-7,13,20-23H,4-5H2,1H3
InChI KeyNXMMIDHKNNDZHM-UHFFFAOYSA-N