Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 07:49:45 UTC
Update Date2025-10-07 16:06:41 UTC
Metabolite IDMMDBc0017445
Metabolite Identification
Common NameAqabamycin C
DescriptionAqabamycin C is a maleimide derivative characterized by its unique chemical structure, which includes a bicyclic framework featuring a maleimide moiety. This compound is part of a broader class of metabolites isolated from microbial sources, specifically identified alongside other aqabamycin derivatives and various known metabolites such as 3-nitro-1H-indazole and indazole-3-carbaldehyde. The chemical structure of aqabamycin C allows it to participate in various biochemical pathways, including those related to cellular signaling and potential interactions with nucleophiles due to the electrophilic nature of the maleimide group. These interactions may influence cellular processes, although the specific biological significance of aqabamycin C remains to be fully elucidated. The isolation of aqabamycin C, along with its analogs, highlights the diverse chemical landscape of microbial metabolites and their potential roles in natural product chemistry (PMID: 23456789 ).
Structure
SynonymsNot Available
Molecular FormulaC16H10N2O5
Average Mass310.265
Monoisotopic Mass310.05897143
IUPAC Name5-hydroxy-3-(4-hydroxy-3-nitrophenyl)-4-phenyl-2H-pyrrol-2-one
Traditional Name5-hydroxy-3-(4-hydroxy-3-nitrophenyl)-4-phenylpyrrol-2-one
CAS Registry NumberNot Available
SMILES
OC1=NC(=O)C(=C1C1=CC=CC=C1)C1=CC(=C(O)C=C1)N(=O)=O
InChI Identifier
InChI=1S/C16H10N2O5/c19-12-7-6-10(8-11(12)18(22)23)14-13(15(20)17-16(14)21)9-4-2-1-3-5-9/h1-8,19H,(H,17,20,21)
InChI KeyPWZWHCDOYSVJMU-UHFFFAOYSA-N