Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 07:50:22 UTC
Update Date2025-10-07 16:06:41 UTC
Metabolite IDMMDBc0017457
Metabolite Identification
Common Name8-methylhomobotcinolide
Description8-methylhomobotcinolide is a lactone derivative belonging to the chemical class of terpenoids. Its chemical structure features a methyl group at the 8-position of the homobotcinolide framework, which contributes to its unique properties. This compound was identified alongside other derivatives in a study that isolated three new compounds, including 3-O-acetylhomobotcinolide and an 11-membered lactone (PMID:16408965 ). In biological contexts, compounds like 8-methylhomobotcinolide may be involved in various metabolic pathways, particularly those associated with terpenoid biosynthesis, which is crucial for the production of numerous secondary metabolites in plants. These pathways can influence plant defense mechanisms and interactions with other organisms, although the specific biological roles of 8-methylhomobotcinolide remain to be fully elucidated. Its structural characteristics suggest potential applications in pharmacology and natural product chemistry, warranting further investigation into its bioactivity and therapeutic potential.
Structure
SynonymsNot Available
Molecular FormulaC23H40O8
Average Mass444.565
Monoisotopic Mass444.272318248
IUPAC Name(3R,4S,5S,6R,7R,8R)-5,6,7-trihydroxy-2,2,4,6,8-pentamethyl-9-oxooxonan-3-yl 4-hydroxydec-2-enoate
Traditional Name(3R,4S,5S,6R,7R,8R)-5,6,7-trihydroxy-2,2,4,6,8-pentamethyl-9-oxooxonan-3-yl 4-hydroxydec-2-enoate
CAS Registry NumberNot Available
SMILES
[H]C(O)(CCCCCC)C=CC(=O)O[C@]1([H])[C@@]([H])(C)[C@]([H])(O)[C@@](C)(O)[C@]([H])(O)[C@@]([H])(C)C(=O)OC1(C)C
InChI Identifier
InChI=1S/C23H40O8/c1-7-8-9-10-11-16(24)12-13-17(25)30-20-14(2)18(26)23(6,29)19(27)15(3)21(28)31-22(20,4)5/h12-16,18-20,24,26-27,29H,7-11H2,1-6H3/t14-,15+,16?,18-,19+,20+,23+/m0/s1
InChI KeySARSXWQMUBQWIQ-MSMLNGQISA-N