Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 07:52:38 UTC
Update Date2025-10-07 16:06:42 UTC
Metabolite IDMMDBc0017511
Metabolite Identification
Common Name4-ketozeinoxanthin
Description4-ketozeinoxanthin is a carotenoid, a class of organic pigments synthesized by various organisms, including plants, bacteria, and fungi. Its chemical structure features a polyene chain with multiple conjugated double bonds, contributing to its characteristic color and function. The biosynthesis of 4-ketozeinoxanthin involves complex metabolic pathways, including the incorporation of specific carotenogenic genes from bacteria, such as crtW, along with liverwort genes MpLCYb, MpLCYe, and MpBHY. These pathways facilitate the conversion of precursors into this carotenoid, highlighting its role in the broader context of carotenoid metabolism. Notably, recombinant Escherichia coli cells have been engineered to produce 4-ketozeinoxanthin, showcasing the potential for biotechnological applications in carotenoid production. This metabolic engineering approach not only enhances the understanding of carotenoid biosynthesis but also opens avenues for the development of novel carotenoids through synthetic biology techniques (PMID:25467956 ).
Structure
SynonymsNot Available
Molecular FormulaC40H54O2
Average Mass566.87
Monoisotopic Mass566.412380979
IUPAC Name6-hydroxy-2,4,4-trimethyl-3-[3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohex-2-en-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaen-1-yl]cyclohex-2-en-1-one
Traditional Name6-hydroxy-2,4,4-trimethyl-3-[3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohex-2-en-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaen-1-yl]cyclohex-2-en-1-one
CAS Registry NumberNot Available
SMILES
CC(C=CC=C(C)C=CC1C(C)=CCCC1(C)C)=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)C(=O)C(O)CC1(C)C
InChI Identifier
InChI=1S/C40H54O2/c1-29(18-13-20-31(3)23-25-35-33(5)22-15-27-39(35,7)8)16-11-12-17-30(2)19-14-21-32(4)24-26-36-34(6)38(42)37(41)28-40(36,9)10/h11-14,16-26,35,37,41H,15,27-28H2,1-10H3
InChI KeyNBZUTADSSFCRRV-UHFFFAOYSA-N