Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 07:53:42 UTC
Update Date2025-10-07 16:06:42 UTC
Metabolite IDMMDBc0017538
Metabolite Identification
Common NameThailandepsin B
DescriptionThailandepsin B is a bicyclic depsipeptide that belongs to the class of natural products known for their diverse biological activities. Its chemical structure features a macrocyclic framework formed through lactonization and the presence of internal disulfide bonds, which contribute to its stability and biological function. Thailandepsin B is primarily isolated from fungi and plants, with potential synthesis pathways involving key reactions such as the Rh-catalyzed hydro-oxycarbonylation of allenes (PMID:38064346 ) and macro-lactonization from the corresponding secoacid (PMID:37424350 ). This compound has garnered attention for its role as a potent histone deacetylase (HDAC) inhibitor, exhibiting selective inhibition profiles that differ from other HDAC inhibitors like FK228 (PMID:37424350 ). The biosynthesis and synthetic schemes of Thailandepsin B have been explored, highlighting its relevance in medicinal chemistry as a lead compound for developing selective HDAC inhibitors (PMID:37424350 ). Its synthesis has been achieved with notable efficiency, demonstrating its potential for further therapeutic applications (PMID:27373645 ). Additionally, analytical methods such as LC-MS/MS have been employed to determine Thailandepsin B levels in biological samples, reflecting its significance in pharmacokinetic studies (PMID:25558934 ).
Structure
SynonymsNot Available
Molecular FormulaC24H39N3O6S2
Average Mass529.71
Monoisotopic Mass529.228028336
IUPAC Name(1S,5S,6R,9S,20R)-6-(butan-2-yl)-20-butyl-5,8,18,21-tetrahydroxy-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docosa-7,15,18,21-tetraen-3-one
Traditional Name(1S,5S,6R,9S,20R)-20-butyl-5,8,18,21-tetrahydroxy-6-(sec-butyl)-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docosa-7,15,18,21-tetraen-3-one
CAS Registry NumberNot Available
SMILES
[H]C(C)(CC)[C@@]1([H])N=C(O)[C@@]2([H])CSSCCC=C[C@]([H])(CC(O)=N[C@]([H])(CCCC)C(O)=N2)OC(=O)C[C@]1([H])O
InChI Identifier
InChI=1S/C24H39N3O6S2/c1-4-6-10-17-23(31)26-18-14-35-34-11-8-7-9-16(12-20(29)25-17)33-21(30)13-19(28)22(15(3)5-2)27-24(18)32/h7,9,15-19,22,28H,4-6,8,10-14H2,1-3H3,(H,25,29)(H,26,31)(H,27,32)/t15?,16-,17-,18-,19+,22-/m1/s1
InChI KeyMUNWAZFRKGVMPQ-WCXJMSLPSA-N