Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 07:57:05 UTC
Update Date2025-10-07 16:04:16 UTC
Metabolite IDMMDBc0017619
Metabolite Identification
Common NameGliotoxin
DescriptionGliotoxin is a potent epipolythiodioxopiperazine (ETP) metabolite produced by the opportunistic pathogen Aspergillus fumigatus, known for its diverse biological activities, including immunosuppression, induction of apoptosis, and antimicrobial effects (PMID:41011559 ). Its chemical structure features a unique disulfide bond that is critical for its biological function, allowing it to interact with various cellular pathways. Gliotoxin is involved in the modulation of immune responses, particularly through the inhibition of T-cell activation, and plays a significant role in promoting apoptosis in lung cancer cells, thereby impeding tumor growth (PMID:40951568 ). Additionally, gliotoxin affects cardiomyocyte electrophysiological properties, highlighting its impact on cardiac function under exposure (PMID:40990321 ). The biosynthesis of gliotoxin is intricately regulated by fungal mitochondria, which also provide mechanisms for self-protection against its toxic effects (PMID:40937851 ). Furthermore, gliotoxin has been implicated in influencing nematode mobility and reproduction, showcasing its ecological significance beyond human health (PMID:40985428 ). Overall, gliotoxin represents a complex interplay of chemistry and biology, with ongoing research aimed at understanding its mechanisms and potential applications in medicine and agriculture (PMID:41011559 ).
Structure
SynonymsNot Available
Molecular FormulaC13H14N2O4S2
Average Mass326.39
Monoisotopic Mass326.039499287
IUPAC Name(1R,7S,8R,11R)-7-hydroxy-11-(hydroxymethyl)-15-methyl-12,13-dithia-9,15-diazatetracyclo[9.2.2.0^{1,9}.0^{3,8}]pentadeca-3,5-diene-10,14-dione
Traditional Name(1R,7S,8R,11R)-7-hydroxy-11-(hydroxymethyl)-15-methyl-12,13-dithia-9,15-diazatetracyclo[9.2.2.0^{1,9}.0^{3,8}]pentadeca-3,5-diene-10,14-dione
CAS Registry NumberNot Available
SMILES
[H][C@@]12N3C(=O)[C@@]4(CO)SS[C@]3(CC1=CC=C[C@]2([H])O)C(=O)N4C
InChI Identifier
InChI=1S/C13H14N2O4S2/c1-14-10(18)12-5-7-3-2-4-8(17)9(7)15(12)11(19)13(14,6-16)21-20-12/h2-4,8-9,16-17H,5-6H2,1H3/t8-,9+,12+,13+/m0/s1
InChI KeyFIVPIPIDMRVLAY-HIAZDOBYSA-N