Xenobiotic
Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 07:57:28 UTC
Update Date2025-10-07 16:06:43 UTC
Metabolite IDMMDBc0017627
Metabolite Identification
Common NameTryptoquivaline F
DescriptionTryptoquivaline F is a secondary metabolite belonging to the class of alkaloids. Its chemical structure features a complex arrangement of carbon, nitrogen, and oxygen atoms, typical of alkaloidal compounds, which often exhibit diverse biological activities. Tryptoquivaline F has been implicated in various biosynthetic pathways within fungi, particularly in the marine-derived fungus Aspergillus fumigatus, where it is produced alongside other metabolites such as pseurotin A and fumiquinazoline C, influenced by the rtfA gene, which regulates fungal growth and conidiation (PMID:28453536 ). Additionally, tryptoquivaline F has been isolated from Neosartorya siamensis, where it, along with other compounds, was evaluated for anti-proliferative activity (PMID:35621953 ). The compound is also subject to post-biosynthetic degradation, as evidenced by the detection of a carbon atom of nonfungal origin during HPLC-HRMS analysis (PMID:23901908 ). Its presence in various fungal species highlights its potential significance in fungal metabolism and secondary metabolite production (PMID:22574452 ; PMID:22319557 ).
Structure
SynonymsNot Available
Molecular FormulaC22H18N4O4
Average Mass402.41
Monoisotopic Mass402.132805076
IUPAC Name(2S,4'R,9S,9aR)-2-methyl-4'-(4-oxo-3,4-dihydroquinazolin-3-yl)-1,2,3,9a-tetrahydrospiro[imidazo[1,2-a]indole-9,2'-oxolane]-3,5'-dione
Traditional Name(2S,4'R,9S,9aR)-2-methyl-4'-(4-oxoquinazolin-3-yl)-2,9a-dihydro-1H-spiro[imidazo[1,2-a]indole-9,2'-oxolane]-3,5'-dione
CAS Registry NumberNot Available
SMILES
[H][C@@]1(C)N[C@]2([H])N(C1=O)C1=CC=CC=C1[C@@]21C[C@@]([H])(N2C=NC3=CC=CC=C3C2=O)C(=O)O1
InChI Identifier
InChI=1S/C22H18N4O4/c1-12-18(27)26-16-9-5-3-7-14(16)22(21(26)24-12)10-17(20(29)30-22)25-11-23-15-8-4-2-6-13(15)19(25)28/h2-9,11-12,17,21,24H,10H2,1H3/t12-,17+,21+,22-/m0/s1
InChI KeyZVBIGFFAMBWOSA-RGKJGADRSA-N