Xenobiotic
Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 07:58:56 UTC
Update Date2025-10-07 16:06:43 UTC
Metabolite IDMMDBc0017663
Metabolite Identification
Common NameGEODIN
DescriptionGEODIN is a secondary metabolite belonging to the chemical class of anthraquinones, known for its diverse bioactivities. Chemically, GEODIN has a complex structure characterized by a fused ring system that is typical of anthraquinones, which contributes to its various biological functions. It is involved in several biosynthetic pathways, particularly in the production of other bioactive compounds. For instance, the geodin biosynthetic pathway includes key enzymes such as GedR and GedA, which play crucial roles in the accumulation of related metabolites like emodin (PMID:36328293 ). Research has shown that modifications to the 4-OH group of GEODIN can enhance its antibacterial and antifungal properties, leading to the development of novel ester derivatives with improved bioactivity (PMID:38462767 , PMID:37865972 ). Additionally, GEODIN and its derivatives have been linked to various health benefits, including cholesterol regulation and anti-inflammatory effects (PMID:38419626 ). Overall, GEODIN exemplifies the intricate relationship between chemical structure and biological activity, making it a significant compound in natural product chemistry.
Structure
SynonymsNot Available
Molecular FormulaC17H12Cl2O7
Average Mass399.18
Monoisotopic Mass397.9960081
IUPAC NameNot Available
Traditional NameNot Available
CAS Registry NumberNot Available
SMILESNot Available
InChI Identifier
InChI=1S/C17H12Cl2O7/c1-6-11(18)13(21)10-14(12(6)19)26-17(15(10)22)8(16(23)25-3)4-7(20)5-9(17)24-2/h4-5,21H,1-3H3
InChI KeyLUBKKVGXMXTXOZ-UHFFFAOYSA-N