Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:00:29 UTC
Update Date2025-10-07 16:06:43 UTC
Metabolite IDMMDBc0017696
Metabolite Identification
Common NameFumonisin b6
DescriptionFumonisin B6 is a member of the fumonisin chemical class, which consists of a group of mycotoxins produced by certain fungi, notably Aspergillus and Fusarium species. Its chemical structure features a long-chain fatty acid backbone with a unique arrangement of hydroxyl and amino functional groups, which contributes to its biological activity. Fumonisin B6 is structurally related to fumonisin B2, differing primarily in the presence of a hydroxyl group at the C-6 position. This compound is involved in various biochemical pathways, particularly in the inhibition of ceramide synthase, leading to the disruption of sphingolipid metabolism. Such interference can result in altered cell signaling and apoptosis, which are critical processes in cellular health and disease. The isolation and characterization of fumonisin B6 from Aspergillus niger have been documented in the literature, highlighting its significance as a metabolite of interest (PMID:20028011 ). Understanding the chemical properties and biological interactions of fumonisin B6 is essential for assessing its potential impacts on health and the environment.
Structure
Synonyms
ValueSource
2-[2-({19-amino-6-[(3,4-dicarboxybutanoyl)oxy]-16,17,18-trihydroxy-5,9-dimethylicosan-7-yl}oxy)-2-oxoethyl]butanedioateGenerator
2-Amino-12,16-dimethyl-3,4,5,14,15-icosanepentaol 14,15-bis[3,4-bis(hydroxycarbonyl)butyric acid]Generator
Molecular FormulaC34H59NO15
Average Mass721.838
Monoisotopic Mass721.388470204
IUPAC Name2-[2-({19-amino-6-[(3,4-dicarboxybutanoyl)oxy]-16,17,18-trihydroxy-5,9-dimethylicosan-7-yl}oxy)-2-oxoethyl]butanedioic acid
Traditional Name2-[2-({19-amino-6-[(3,4-dicarboxybutanoyl)oxy]-16,17,18-trihydroxy-5,9-dimethylicosan-7-yl}oxy)-2-oxoethyl]butanedioic acid
CAS Registry NumberNot Available
SMILES
CCCCC(C)C(OC(=O)CC(CC(O)=O)C(O)=O)C(CC(C)CCCCCCC(O)C(O)C(O)C(C)N)OC(=O)CC(CC(O)=O)C(O)=O
InChI Identifier
InChI=1S/C34H59NO15/c1-5-6-12-20(3)32(50-29(42)18-23(34(47)48)16-27(39)40)25(49-28(41)17-22(33(45)46)15-26(37)38)14-19(2)11-9-7-8-10-13-24(36)31(44)30(43)21(4)35/h19-25,30-32,36,43-44H,5-18,35H2,1-4H3,(H,37,38)(H,39,40)(H,45,46)(H,47,48)
InChI KeyWQXBMSIHHKRGPX-UHFFFAOYSA-N