Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:03:51 UTC
Update Date2025-10-07 16:06:43 UTC
Metabolite IDMMDBc0017745
Metabolite Identification
Common NameBrevione K
DescriptionBrevione K is a secondary metabolite belonging to the class of polyketides. Its chemical structure features a complex arrangement of carbon rings and functional groups, characteristic of many natural products derived from microbial sources. In terms of its biochemical interactions, Brevione K has been shown to exhibit significant binding affinity towards the dengue virus NS5 methyltransferase, with a binding energy of -7.4 kcal/mol, indicating its potential role in inhibiting viral replication pathways (PMID:35372666 ). Additionally, Brevione K shares structural similarities with other compounds such as budesonide and colchicine, which may suggest overlapping mechanisms of action or biological pathways influenced by this metabolite (PMID:35372666 ). The exploration of Brevione K's interactions within these pathways could provide insights into its potential therapeutic applications, particularly in the context of viral infections.
Structure
SynonymsNot Available
Molecular FormulaC27H30O5
Average Mass434.532
Monoisotopic Mass434.209324066
IUPAC Name(4S,4aR,6aS,11aS,11bR)-3,4a,6',7,7',11a-hexamethyl-1,3',4',4a,5,6,6a,9,11a,11b-decahydrospiro[cyclohepta[a]naphthalene-4,2'-furo[3,2-c]pyran]-1,4',9-trione
Traditional Name(4S,4aR,6aS,11aS,11bR)-3,4a,6',7,7',11a-hexamethyl-5,6,6a,11b-tetrahydro-3'H-spiro[cyclohepta[a]naphthalene-4,2'-furo[3,2-c]pyran]-1,4',9-trione
CAS Registry NumberNot Available
SMILES
[H][C@@]12CC[C@]3(C)[C@]([H])(C(=O)C=C(C)[C@@]33CC4=C(O3)C(C)=C(C)OC4=O)[C@@]1(C)C=CC(=O)C=C2C
InChI Identifier
InChI=1S/C27H30O5/c1-14-11-18(28)7-9-25(5)20(14)8-10-26(6)23(25)21(29)12-15(2)27(26)13-19-22(32-27)16(3)17(4)31-24(19)30/h7,9,11-12,20,23H,8,10,13H2,1-6H3/t20-,23+,25-,26+,27-/m0/s1
InChI KeyQLGBMJAKRNXWHJ-QCYUWTFZSA-N