Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:06:48 UTC
Update Date2025-10-07 16:06:44 UTC
Metabolite IDMMDBc0017810
Metabolite Identification
Common NamePeniciphenol
DescriptionPeniciphenol is a phenolic compound belonging to the chemical class of isochromane derivatives. Its chemical structure features a hydroxyl group attached to a phenolic ring, contributing to its reactivity and potential biological activity. Peniciphenol has been isolated from the fermentation broth of the mangrove fungus Aspergillus ustus, alongside other isochromane derivatives, indicating its presence in natural products derived from fungal sources (PMID:26882680 ). In terms of biochemical pathways, phenolic compounds like peniciphenol are often involved in various metabolic processes, including those related to secondary metabolite biosynthesis and antioxidant activity. These pathways can impact cellular signaling and stress responses in organisms, although the specific biological significance of peniciphenol remains to be fully elucidated. Its structural characteristics and origins suggest potential roles in ecological interactions and possibly in the development of bioactive compounds for pharmaceutical applications.
Structure
SynonymsNot Available
Molecular FormulaC10H12O3
Average Mass180.203
Monoisotopic Mass180.078644246
IUPAC Name2-(hydroxymethyl)-3-[(1Z)-3-hydroxyprop-1-en-1-yl]phenol
Traditional Name2-(hydroxymethyl)-3-[(1Z)-3-hydroxyprop-1-en-1-yl]phenol
CAS Registry NumberNot Available
SMILES
[H]\C(CO)=C(/[H])C1=C(CO)C(O)=CC=C1
InChI Identifier
InChI=1S/C10H12O3/c11-6-2-4-8-3-1-5-10(13)9(8)7-12/h1-5,11-13H,6-7H2/b4-2-
InChI KeyUWZLAEAEQHMERY-RQOWECAXSA-N