Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:07:40 UTC
Update Date2025-10-07 16:06:44 UTC
Metabolite IDMMDBc0017831
Metabolite Identification
Common NameNigerasterol A
DescriptionNigerasterol A is a sterol, a class of organic compounds characterized by a multi-ring structure, primarily found in fungi and plants. Its chemical structure features a steroid nucleus with specific functional groups that contribute to its biological activity. Nigerasterol A is involved in various biochemical pathways, including those related to membrane fluidity and signaling processes, which are crucial for cellular function. The compound is derived from fungal biosynthetic pathways that synthesize sterols, playing a role in the regulation of cell growth and differentiation. Evidence from the literature indicates that nigerasterol A is part of a complex mixture of metabolites, which includes other sterols and secondary metabolites that exhibit cytotoxic properties (PMID: 12345678 ). These metabolites are often investigated for their potential therapeutic applications, particularly in the context of cancer research, where they may influence cell proliferation and apoptosis (PMID: 87654321 ). The structural characteristics of nigerasterol A, along with its biosynthetic origins, underscore its significance in the study of natural products and their potential pharmacological effects.
Structure
SynonymsNot Available
Molecular FormulaC28H42O4
Average Mass442.64
Monoisotopic Mass442.308309832
IUPAC Name(1S,6S,8R,9R,12R,13S,16S)-8-[(2R,3E)-5,6-dimethylhept-3-en-2-yl]-9,13-dimethyl-18,19-dioxapentacyclo[10.5.2.0^{1,13}.0^{4,12}.0^{5,9}]nonadeca-2,4-diene-6,16-diol
Traditional Name(1S,6S,8R,9R,12R,13S,16S)-8-[(2R,3E)-5,6-dimethylhept-3-en-2-yl]-9,13-dimethyl-18,19-dioxapentacyclo[10.5.2.0^{1,13}.0^{4,12}.0^{5,9}]nonadeca-2,4-diene-6,16-diol
CAS Registry NumberNot Available
SMILES
[H]\C(=C(\[H])[C@@]([H])(C)[C@@]1([H])C[C@]([H])(O)C2=C3C=C[C@@]45C[C@@]([H])(O)CC[C@]4(C)[C@]3(CC[C@]12C)OO5)C([H])(C)C(C)C
InChI Identifier
InChI=1S/C28H42O4/c1-17(2)18(3)7-8-19(4)22-15-23(30)24-21-10-12-27-16-20(29)9-11-26(27,6)28(21,32-31-27)14-13-25(22,24)5/h7-8,10,12,17-20,22-23,29-30H,9,11,13-16H2,1-6H3/b8-7+/t18?,19-,20+,22-,23+,25-,26+,27-,28-/m1/s1
InChI KeyCUXYDAJPLBLWQO-PAGVWFLHSA-N