Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:11:05 UTC
Update Date2025-10-07 16:06:45 UTC
Metabolite IDMMDBc0017897
Metabolite Identification
Common NamePenicisochroman G
DescriptionPenicisochroman G is a natural product belonging to the class of chroman derivatives, specifically a metabolite associated with the penicillin biosynthetic pathway. Its chemical structure features a chroman ring fused with a penicillin-like core, which contributes to its unique pharmacological properties. This compound has been studied for its potential neuroprotective effects, as evidenced by its ability to significantly lower pentylenetetrazol (PTZ)-induced seizures, indicating involvement in pathways related to seizure modulation and neuroprotection (PMID:31731399 ). The presence of the chroman moiety suggests potential interactions with various biological targets, possibly influencing neurotransmitter systems or ion channels. Further research into Penicisochroman G could elucidate its mechanisms of action and therapeutic potential in neurological disorders.
Structure
SynonymsNot Available
Molecular FormulaC15H16O3
Average Mass244.29
Monoisotopic Mass244.109944375
IUPAC Name(2S)-7-methyl-2-(propan-2-yl)-2H,3H,9H-furo[3,2-h]isochromen-3-one
Traditional Name(2S)-2-isopropyl-7-methyl-2H,9H-furo[3,2-h]isochromen-3-one
CAS Registry NumberNot Available
SMILES
[H][C@]1(OC2=C(C=CC3=C2COC(C)=C3)C1=O)C(C)C
InChI Identifier
InChI=1S/C15H16O3/c1-8(2)14-13(16)11-5-4-10-6-9(3)17-7-12(10)15(11)18-14/h4-6,8,14H,7H2,1-3H3/t14-/m0/s1
InChI KeySVFIJYQKYCVHPU-AWEZNQCLSA-N