Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:21:51 UTC
Update Date2025-10-07 16:06:47 UTC
Metabolite IDMMDBc0018121
Metabolite Identification
Common NameBotcinic acid
DescriptionBotcinic acid is a polyketide metabolite involved in the virulence of the gray mold fungus Botrytis cinerea. Its chemical structure is characterized by a complex arrangement of carbon chains and functional groups typical of polyketides, which are synthesized through the polyketide synthase pathway. Botcinic acid plays a significant role in various biochemical pathways, including the regulation of virulence factors during host colonization, as evidenced by the induction of genes encoding botcinic acid and other potential effectors in infected plants (PMID:35778800 ). The biosynthesis of botcinic acid is orchestrated by a subtelomeric gene cluster regulated by the Zn(2)Cys(6) transcription factor BcBoa13, which positively influences the expression of its biosynthetic genes (PMID:30848345 ). Comparative genomic studies have revealed that this cluster shares similarities with other phytotoxin biosynthetic pathways, underscoring its importance in pathogen interaction with hosts (PMID:31898475 ). Additionally, isotopic labeling experiments indicate that botcinic acid is part of a broader network of polyketide toxins produced by B. cinerea, linking it to other toxic metabolites such as botrylactones (PMID:23203902 ).
Structure
Synonyms
ValueSource
BotcinateGenerator
Molecular FormulaC20H34O8
Average Mass402.484
Monoisotopic Mass402.225368055
IUPAC Name(2R,3S)-3-hydroxy-3-[(2S,3S,4S,5R,6S)-3-hydroxy-5-{[(2E,4S)-4-hydroxyoct-2-enoyl]oxy}-2,4,6-trimethyloxan-2-yl]-2-methylpropanoic acid
Traditional Name(2R,3S)-3-hydroxy-3-[(2S,3S,4S,5R,6S)-3-hydroxy-5-{[(2E,4S)-4-hydroxyoct-2-enoyl]oxy}-2,4,6-trimethyloxan-2-yl]-2-methylpropanoic acid
CAS Registry NumberNot Available
SMILES
[H]C(=C([H])[C@@]([H])(O)CCCC)C(=O)O[C@@]1([H])[C@]([H])(C)O[C@](C)([C@@]([H])(O)[C@@]([H])(C)C(O)=O)[C@@]([H])(O)[C@]1([H])C
InChI Identifier
InChI=1S/C20H34O8/c1-6-7-8-14(21)9-10-15(22)27-16-11(2)17(23)20(5,28-13(16)4)18(24)12(3)19(25)26/h9-14,16-18,21,23-24H,6-8H2,1-5H3,(H,25,26)/b10-9+/t11-,12-,13+,14+,16-,17+,18+,20+/m1/s1
InChI KeyXGNHXARWXKZZNY-HZVPPPABSA-N