Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:32:07 UTC
Update Date2025-10-07 16:06:49 UTC
Metabolite IDMMDBc0018331
Metabolite Identification
Common NameMarcfortine A
DescriptionMarcfortine A is a secondary metabolite belonging to the class of polyketides, specifically produced by the fungus Penicillium roqueforti. Its chemical structure features a complex arrangement of rings, including a six-membered ring G that is devoid of substituents, distinguishing it from its structural analog paraherquamide A, which contains additional functional groups. Marcfortine A is involved in various biochemical pathways, particularly those related to the synthesis of other mycotoxins and antifungal agents. It has been identified in complex mixtures alongside other toxic compounds such as mycophenolic acid and roquefortines, highlighting its prevalence in contaminated silage and fungal metabolites (PMID:35347677 , PMID:27707355 , PMID:20213172 ). Additionally, marcfortine A has demonstrated potent antiparasitic properties, making it a candidate for further pharmacological exploration (PMID:12945765 ). Its structural relationship to paraherquamide A suggests potential for development as an anthelmintic agent (PMID:12052190 ). Overall, marcfortine A represents a significant compound within the realm of fungal metabolites, contributing to both ecological interactions and potential therapeutic applications.
Structure
SynonymsNot Available
Molecular FormulaC28H35N3O4
Average Mass477.605
Monoisotopic Mass477.262756619
IUPAC Name(1'S,8R,8'S,10'S)-9-hydroxy-4,4,11',11',14'-pentamethyl-4H-3',14'-diazaspiro[[1,4]dioxepino[2,3-g]indole-8,12'-tetracyclo[6.5.2.0^{1,10}.0^{3,8}]pentadecane]-15'-one
Traditional Name(1'S,8R,8'S,10'S)-9-hydroxy-4,4,11',11',14'-pentamethyl-3',14'-diazaspiro[[1,4]dioxepino[2,3-g]indole-8,12'-tetracyclo[6.5.2.0^{1,10}.0^{3,8}]pentadecane]-15'-one
CAS Registry NumberNot Available
SMILES
[H][C@@]12C[C@]34CCCCN3C[C@@]1(C[C@@]1(C(O)=NC3=C1C=CC1=C3OC=CC(C)(C)O1)C2(C)C)N(C)C4=O
InChI Identifier
InChI=1S/C28H35N3O4/c1-24(2)11-13-34-21-18(35-24)9-8-17-20(21)29-22(32)28(17)15-27-16-31-12-7-6-10-26(31,23(33)30(27)5)14-19(27)25(28,3)4/h8-9,11,13,19H,6-7,10,12,14-16H2,1-5H3,(H,29,32)/t19-,26-,27+,28+/m0/s1
InChI KeyKYKUTNUWXQVSSU-ZALBMCOMSA-N