Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:37:15 UTC
Update Date2025-10-07 16:06:49 UTC
Metabolite IDMMDBc0018424
Metabolite Identification
Common NameAspernigrin B
DescriptionAspernigrin B is a secondary metabolite belonging to the class of diketopiperazines. Its chemical structure features a complex arrangement that includes a furan-2,5-dione moiety, contributing to its unique properties. This compound has been isolated from marine-derived fungi, highlighting the diverse biosynthetic pathways these organisms utilize to produce bioactive metabolites. Aspernigrin B is involved in various biochemical pathways, including those related to neuroprotection, as evidenced by its strong neuroprotective effect against glutamic acid-induced toxicity (PMID:15387655 ). The intricate chemical structure of Aspernigrin B, alongside its biological activities, underscores the potential of marine fungi as a source of novel therapeutic agents.
Structure
SynonymsNot Available
Molecular FormulaC27H24N2O5
Average Mass456.498
Monoisotopic Mass456.168521881
IUPAC Name6-benzyl-1-[(1S)-1-(4-methoxy-2-oxo-2H-pyran-6-yl)-2-phenylethyl]-4-oxo-1,4-dihydropyridine-3-carboximidic acid
Traditional Name6-benzyl-1-[(1S)-1-(4-methoxy-6-oxopyran-2-yl)-2-phenylethyl]-4-oxopyridine-3-carboximidic acid
CAS Registry NumberNot Available
SMILES
[H][C@@](CC1=CC=CC=C1)(N1C=C(C(O)=N)C(=O)C=C1CC1=CC=CC=C1)C1=CC(OC)=CC(=O)O1
InChI Identifier
InChI=1S/C27H24N2O5/c1-33-21-15-25(34-26(31)16-21)23(13-19-10-6-3-7-11-19)29-17-22(27(28)32)24(30)14-20(29)12-18-8-4-2-5-9-18/h2-11,14-17,23H,12-13H2,1H3,(H2,28,32)/t23-/m0/s1
InChI KeyCPVCVIXCXKPURM-QHCPKHFHSA-N