Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:37:19 UTC
Update Date2025-10-07 16:06:49 UTC
Metabolite IDMMDBc0018426
Metabolite Identification
Common Name6-methoxyspirotryprostatin B
Description6-methoxyspirotryprostatin B is a diketopiperazine alkaloid known for its unique chemical structure, which features a spirocyclic arrangement. This compound is derived from the endophytic fungus Aspergillus fumigatus, where it was isolated alongside several other alkaloids (PMID:26111169 ). The chemical structure of 6-methoxyspirotryprostatin B includes a methoxy group and a spirocyclic framework that contributes to its biological activity. In terms of biochemical pathways, compounds like 6-methoxyspirotryprostatin B are often involved in various cellular processes, including modulation of signaling pathways and potential interactions with protein targets, although specific pathways for this compound have not been extensively detailed in the literature. Its structural features suggest possible interactions with enzymes or receptors, which could influence cellular responses. The exploration of such alkaloids continues to provide insights into their potential roles in pharmacology and biochemistry, highlighting the importance of natural products in drug discovery and development.
Structure
SynonymsNot Available
Molecular FormulaC22H23N3O4
Average Mass393.443
Monoisotopic Mass393.168856233
IUPAC Name(3S,6'S,9'S)-2-hydroxy-6-methoxy-6'-(2-methylprop-1-en-1-yl)-1',7'-diazaspiro[indole-3,5'-tricyclo[7.3.0.0^{3,7}]dodecan]-3'-ene-2',8'-dione
Traditional Name(3S,6'S,9'S)-2-hydroxy-6-methoxy-6'-(2-methylprop-1-en-1-yl)-1',7'-diazaspiro[indole-3,5'-tricyclo[7.3.0.0^{3,7}]dodecan]-3'-ene-2',8'-dione
CAS Registry NumberNot Available
SMILES
[H][C@@]12CCCN1C(=O)C1=C[C@@]3(C(O)=NC4=C3C=CC(OC)=C4)[C@]([H])(C=C(C)C)N1C2=O
InChI Identifier
InChI=1S/C22H23N3O4/c1-12(2)9-18-22(14-7-6-13(29-3)10-15(14)23-21(22)28)11-17-19(26)24-8-4-5-16(24)20(27)25(17)18/h6-7,9-11,16,18H,4-5,8H2,1-3H3,(H,23,28)/t16-,18-,22-/m0/s1
InChI KeyUHQKDPCPFNXIDU-ZJBJCVSYSA-N