Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:39:03 UTC
Update Date2025-10-07 16:06:49 UTC
Metabolite IDMMDBc0018461
Metabolite Identification
Common NameBrevianamide K
DescriptionBrevianamide K is a diketopiperazine alkaloid, a class of compounds known for their diverse biological activities. It is produced by the fungal strain Aspergillus sp. and is characterized by a unique 3,6-diene-2,5-diketopiperazine substructure, formed through the action of an FeII/2-oxoglutarate-dependent oxidase (AspE) and a heme-dependent P450 enzyme (AspF) during biosynthesis (PMID:36750406 ). Chemical analysis of metabolites from this strain revealed brevianamide K alongside other known compounds (PMID:39860162 ). In biological contexts, brevianamide K has been shown to regulate the activation of nuclear factor kappa-light-chain-enhancer of activated B cells (NF-κB) signaling, indicating its potential role in cellular pathways related to inflammation and immune response (PMID:39860162 ). This signaling pathway is crucial in various physiological processes and disease states, suggesting that brevianamide K may have implications in treating neurodegenerative diseases (PMID:39860162 ). Overall, brevianamide K exemplifies the intricate chemistry of fungal metabolites and their potential therapeutic applications.
Structure
SynonymsNot Available
Molecular FormulaC21H21N3O2
Average Mass347.418
Monoisotopic Mass347.163376928
IUPAC Name(3Z)-1-hydroxy-3-{[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methylidene}-3H,4H,6H,7H-pyrrolo[1,2-a]pyrazin-4-one
Traditional Name(3Z)-1-hydroxy-3-{[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methylidene}-6H,7H-pyrrolo[1,2-a]pyrazin-4-one
CAS Registry NumberNot Available
SMILES
[H]\C(C1=C(NC2=CC=CC=C12)C(C)(C)C=C)=C1\N=C(O)C2=CCCN2C1=O
InChI Identifier
InChI=1S/C21H21N3O2/c1-4-21(2,3)18-14(13-8-5-6-9-15(13)22-18)12-16-20(26)24-11-7-10-17(24)19(25)23-16/h4-6,8-10,12,22H,1,7,11H2,2-3H3,(H,23,25)/b16-12-
InChI KeyVLLSKMDBWJJQDE-VBKFSLOCSA-N