Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:45:57 UTC
Update Date2025-10-07 16:06:51 UTC
Metabolite IDMMDBc0018581
Metabolite Identification
Common Name(+)-formylanserinone B
Description(+)-formylanserinone B is a sesquiterpenoid metabolite described in biomedical literature. It is characterized by a complex chemical structure that includes a carbon backbone typical of sesquiterpenoids, which are known for their diverse biological activities. This compound has been isolated from the rice fermentation of the fungus Antrodiella albocinnamomea, alongside other metabolites such as steperoxide A and dankasterone (PMID:35630824 ). Additionally, (+)-formylanserinone B was identified in a marine-derived saltwater fungal culture, where it was found alongside other pentaketides and fungal pigments, indicating its potential role in the metabolic pathways of these fungi (PMID:15043411 ). The pathways involving sesquiterpenoids like (+)-formylanserinone B often include biosynthesis and secondary metabolite production, which can contribute to the ecological interactions of fungi with their environment.
Structure
SynonymsNot Available
Molecular FormulaC12H14O5
Average Mass238.239
Monoisotopic Mass238.084123551
IUPAC Name(2S)-1-(5-methoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)propan-2-yl formate
Traditional Name(2S)-1-(5-methoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)propan-2-yl formate
CAS Registry NumberNot Available
SMILES
[H][C@](C)(CC1=C(C)C(=O)C=C(OC)C1=O)OC=O
InChI Identifier
InChI=1S/C12H14O5/c1-7(17-6-13)4-9-8(2)10(14)5-11(16-3)12(9)15/h5-7H,4H2,1-3H3/t7-/m0/s1
InChI KeyKYLJUIHXTUMDNE-ZETCQYMHSA-N