Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:46:20 UTC
Update Date2025-10-07 16:04:16 UTC
Metabolite IDMMDBc0018590
Metabolite Identification
Common NameSurfactin
DescriptionSurfactin is a lipopeptide belonging to the chemical class of biosurfactants. It is produced by various Bacillus species, particularly Bacillus subtilis, and is characterized by its unique cyclic structure composed of a fatty acid chain linked to a peptide ring. The chemical structure of surfactin includes a β-hydroxy fatty acid and a cyclic heptapeptide, which contributes to its surface-active properties. Surfactin is involved in several biochemical pathways, including antifungal activity, as evidenced by the identification of biosynthetic genes such as srfAB in the genomes of Bacillus species (PMID:41050548 ). It has been shown to inhibit biofilm formation in various bacterial strains, with a minimum biofilm inhibitory concentration (MBIC) of 5 µg/mL, significantly reducing extracellular polymeric substances on surfaces (PMID:41011461 ). Additionally, surfactin, along with other lipopeptides, plays a role in the biosynthesis of antifungal compounds, as confirmed by genome sequencing studies (PMID:41050548 ). The presence of surfactin in Bacillus-HT1 and Bacillus-HT2 highlights its potential as an eco-friendly antimicrobial agent (PMID:41031829 ). Overall, surfactin's unique chemical properties and its involvement in various biosynthetic pathways underscore its significance in microbial ecology and potential applications in biocontrol.
Structure
Synonyms
ValueSource
3-[(3S,6R,9S,12S,15R,18S,21S)-9-(Carboxymethyl)-5,8,11,14,17,20,23-heptahydroxy-3,6,15,18-tetrakis(2-methylpropyl)-2-oxo-12-(propan-2-yl)-25-undecyl-1-oxa-4,7,10,13,16,19,22-heptaazacyclopentacosa-4,7,10,13,16,19,22-heptaen-21-yl]propanoateGenerator
Molecular FormulaC52H91N7O13
Average Mass1022.336
Monoisotopic Mass1021.667486018
IUPAC Name3-[(3S,6R,9S,12S,15R,18S,21S)-9-(carboxymethyl)-5,8,11,14,17,20,23-heptahydroxy-3,6,15,18-tetrakis(2-methylpropyl)-2-oxo-12-(propan-2-yl)-25-undecyl-1-oxa-4,7,10,13,16,19,22-heptaazacyclopentacosa-4,7,10,13,16,19,22-heptaen-21-yl]propanoic acid
Traditional Name3-[(3S,6R,9S,12S,15R,18S,21S)-9-(carboxymethyl)-5,8,11,14,17,20,23-heptahydroxy-12-isopropyl-3,6,15,18-tetrakis(2-methylpropyl)-2-oxo-25-undecyl-1-oxa-4,7,10,13,16,19,22-heptaazacyclopentacosa-4,7,10,13,16,19,22-heptaen-21-yl]propanoic acid
CAS Registry NumberNot Available
SMILES
[H]C1(CCCCCCCCCCC)CC(O)=N[C@@]([H])(CCC(O)=O)C(O)=N[C@@]([H])(CC(C)C)C(O)=N[C@]([H])(CC(C)C)C(O)=N[C@@]([H])(C(C)C)C(O)=N[C@@]([H])(CC(O)=O)C(O)=N[C@]([H])(CC(C)C)C(O)=N[C@@]([H])(CC(C)C)C(=O)O1
InChI Identifier
InChI=1S/C52H91N7O13/c1-12-13-14-15-16-17-18-19-20-21-35-28-42(60)53-36(22-23-43(61)62)46(65)54-37(24-30(2)3)47(66)56-39(26-32(6)7)50(69)59-45(34(10)11)51(70)57-40(29-44(63)64)49(68)55-38(25-31(4)5)48(67)58-41(27-33(8)9)52(71)72-35/h30-41,45H,12-29H2,1-11H3,(H,53,60)(H,54,65)(H,55,68)(H,56,66)(H,57,70)(H,58,67)(H,59,69)(H,61,62)(H,63,64)/t35?,36-,37-,38+,39+,40-,41-,45-/m0/s1
InChI KeyAFWTZXXDGQBIKW-DZESRJJCSA-N