Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:46:35 UTC
Update Date2025-10-07 16:06:51 UTC
Metabolite IDMMDBc0018596
Metabolite Identification
Common NameTerreulactone A
DescriptionTerreulactone A is a polyketide, a class of natural products characterized by their diverse structures and biological activities. Its chemical structure features a complex arrangement of rings, specifically the A, B, and C rings, which are integral to its molecular identity. The synthesis of terreulactone A has been the focus of research, highlighting methods for the rapid construction of these rings, as evidenced by studies that detail an efficient synthesis pathway (PMID:16435850 ). This compound is involved in various biochemical pathways, although specific biological significance is not the focus here. The intricate nature of its structure and the synthetic approaches developed for its assembly underscore the complexity and potential of terreulactone A within the realm of natural product chemistry. The ongoing exploration of its synthesis not only enhances our understanding of its chemical properties but also opens avenues for further investigation into its biological interactions and potential applications.
Structure
SynonymsNot Available
Molecular FormulaC28H30O9
Average Mass510.539
Monoisotopic Mass510.188982546
IUPAC Name(1R,4R,13S,14R,16R)-13-hydroxy-16-methoxy-8-(4-methoxyphenyl)-4,14,19,19-tetramethyl-5,9,18-trioxapentacyclo[14.2.1.0^{1,14}.0^{4,13}.0^{6,11}]nonadeca-6(11),7-diene-10,15,17-trione
Traditional Name(1R,4R,13S,14R,16R)-13-hydroxy-16-methoxy-8-(4-methoxyphenyl)-4,14,19,19-tetramethyl-5,9,18-trioxapentacyclo[14.2.1.0^{1,14}.0^{4,13}.0^{6,11}]nonadeca-6(11),7-diene-10,15,17-trione
CAS Registry NumberNot Available
SMILES
COC1=CC=C(C=C1)C1=CC2=C(C[C@]3(O)[C@@]4(C)C(=O)[C@@]5(OC)C(=O)O[C@]4(CC[C@@]3(C)O2)C5(C)C)C(=O)O1
InChI Identifier
InChI=1S/C28H30O9/c1-23(2)27-12-11-24(3)26(32,25(27,4)21(30)28(23,34-6)22(31)37-27)14-17-19(36-24)13-18(35-20(17)29)15-7-9-16(33-5)10-8-15/h7-10,13,32H,11-12,14H2,1-6H3/t24-,25-,26-,27-,28+/m1/s1
InChI KeyAOFMVUCAUSHJLI-FXGKLIOSSA-N