Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:47:52 UTC
Update Date2025-10-07 16:06:51 UTC
Metabolite IDMMDBc0018625
Metabolite Identification
Common Name3,3'-dihydroxyisorenieratene
Description3,3'-dihydroxyisorenieratene is a natural carotenoid belonging to the class of polyenes. Its chemical structure features a series of conjugated double bonds, which contribute to its unique optical properties and antioxidant capabilities. This compound is involved in various biochemical pathways, demonstrating its role in photoprotection and cellular defense mechanisms. For instance, 3,3'-dihydroxyisorenieratene has been shown to prevent UV-induced DNA damage in human skin fibroblasts (PMID:22634149 ) and to inhibit the formation of reactive oxygen species, thereby protecting cellular integrity (PMID:19862772 ). Additionally, it exhibits bifunctional antioxidant properties, making it a subject of interest for enhancing antiproliferative activity in cancer research (PMID:24925256 ). Studies have also explored its excited-state dynamics, revealing insights into its vibrationally hot S(0) species (PMID:29605493 ). Overall, 3,3'-dihydroxyisorenieratene is recognized for its structural uniqueness and potential therapeutic applications, particularly in the context of oxidative stress and skin protection (PMID:19034947 ).
Structure
SynonymsNot Available
Molecular FormulaC40H48O2
Average Mass560.822
Monoisotopic Mass560.365430786
IUPAC Name4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-(4-hydroxy-2,3,6-trimethylphenyl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaen-1-yl]-2,3,5-trimethylphenol
Traditional Name4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-(4-hydroxy-2,3,6-trimethylphenyl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaen-1-yl]-2,3,5-trimethylphenol
CAS Registry NumberNot Available
SMILES
[H]/C(=C(/[H])\C(\[H])=C(/C)\C(\[H])=C(/[H])\C(\[H])=C(/C)\C(\[H])=C(/[H])C1=C(C)C=C(O)C(C)=C1C)/C(/[H])=C(\C)/C(/[H])=C(\[H])/C(/[H])=C(\C)/C(/[H])=C(\[H])C1=C(C)C=C(O)C(C)=C1C
InChI Identifier
InChI=1S/C40H48O2/c1-27(17-13-19-29(3)21-23-37-31(5)25-39(41)35(9)33(37)7)15-11-12-16-28(2)18-14-20-30(4)22-24-38-32(6)26-40(42)36(10)34(38)8/h11-26,41-42H,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,27-15+,28-16+,29-19+,30-20+
InChI KeyFWOPDDPAGBEMTG-QISQUURKSA-N