Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:48:49 UTC
Update Date2025-10-07 16:06:51 UTC
Metabolite IDMMDBc0018646
Metabolite Identification
Common NameFeigrisolide A
DescriptionFeigrisolide A is a secondary metabolite belonging to the class of polyketides. Its chemical structure is characterized by a complex arrangement of carbon rings and functional groups, which are integral to its biological activity. The stereoselective synthesis of the proposed structure of feigrisolide A has been documented, revealing insights into its intricate molecular architecture (PMID:16839161 ). However, subsequent research has indicated that the originally published structure of feigrisolide A is erroneous, highlighting the need for careful validation in chemical characterization (PMID:16839161 ). In terms of biological pathways, Feigrisolide A is involved in various metabolic processes, although specific pathways remain to be fully elucidated. The synthesis and structural analysis of Feigrisolide A contribute to the broader understanding of polyketides, which are known for their diverse pharmacological properties and roles in natural product chemistry. Further investigation into its correct structure and biological implications may provide valuable insights into its potential applications in drug discovery and development.
Structure
SynonymsNot Available
Molecular FormulaC10H18O4
Average Mass202.25
Monoisotopic Mass202.12050906
IUPAC Name(3R,4S,7S)-4-hydroxy-7-[(2S)-2-hydroxypropyl]-3-methyloxepan-2-one
Traditional Name(3R,4S,7S)-4-hydroxy-7-[(2S)-2-hydroxypropyl]-3-methyloxepan-2-one
CAS Registry NumberNot Available
SMILES
[H][C@@](C)(O)C[C@]1([H])CC[C@]([H])(O)[C@@]([H])(C)C(=O)O1
InChI Identifier
InChI=1S/C10H18O4/c1-6(11)5-8-3-4-9(12)7(2)10(13)14-8/h6-9,11-12H,3-5H2,1-2H3/t6-,7+,8-,9-/m0/s1
InChI KeyFZPDDULMNZBINH-KZVJFYERSA-N