Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:50:46 UTC
Update Date2025-10-07 16:06:52 UTC
Metabolite IDMMDBc0018687
Metabolite Identification
Common NamePrecarriebowmide
DescriptionPrecarriebowmide is a lipopeptide, a class of compounds characterized by the presence of both lipid and peptide components. Its chemical structure features a fatty acid chain linked to an amino acid sequence, which is typical of lipopeptides, allowing for diverse biological activities. This compound is derived from the marine cyanobacterium Moorea producens, where it was isolated alongside another lipopeptide, parguerene. Precarriebowmide exhibits a minor structural modification compared to its analogs, carriebowmide and carriebowmide sulfone, suggesting potential variations in function and interaction pathways. In terms of biological pathways, lipopeptides like precarriebowmide are often involved in signaling mechanisms and may play roles in microbial competition and defense, contributing to the ecological dynamics of their marine environment. The unique structural features of precarriebowmide could influence its interactions with cellular membranes and receptors, further implicating it in various biochemical pathways. Understanding the chemistry and biological roles of precarriebowmide can provide insights into its potential applications in biotechnology and pharmacology. (PMID:24044577 )
Structure
SynonymsNot Available
Molecular FormulaC46H68N6O8S
Average Mass865.14
Monoisotopic Mass864.481934348
IUPAC Name(2R,5R,8S,11S,14S,17S,20R,21S)-5,11-dibenzyl-6,9,15,18-tetrahydroxy-4,13,17,21-tetramethyl-14-(2-methylpropyl)-8-[2-(methylsulfanyl)ethyl]-2-(propan-2-yl)-20-propyl-1-oxa-4,7,10,13,16,19-hexaazacyclodocosa-6,9,15,18-tetraene-3,12,22-trione
Traditional Name(2R,5R,8S,11S,14S,17S,20R,21S)-5,11-dibenzyl-6,9,15,18-tetrahydroxy-2-isopropyl-4,13,17,21-tetramethyl-14-(2-methylpropyl)-8-[2-(methylsulfanyl)ethyl]-20-propyl-1-oxa-4,7,10,13,16,19-hexaazacyclodocosa-6,9,15,18-tetraene-3,12,22-trione
CAS Registry NumberNot Available
SMILES
[H][C@@]1(C)N=C(O)[C@]([H])(CC(C)C)N(C)C(=O)[C@]([H])(CC2=CC=CC=C2)N=C(O)[C@]([H])(CCSC)N=C(O)[C@@]([H])(CC2=CC=CC=C2)N(C)C(=O)[C@]([H])(OC(=O)[C@@]([H])(C)[C@@]([H])(CCC)N=C1O)C(C)C
InChI Identifier
InChI=1S/C46H68N6O8S/c1-11-18-34-30(6)46(59)60-39(29(4)5)45(58)52(9)38(27-33-21-16-13-17-22-33)43(56)49-35(23-24-61-10)41(54)50-36(26-32-19-14-12-15-20-32)44(57)51(8)37(25-28(2)3)42(55)47-31(7)40(53)48-34/h12-17,19-22,28-31,34-39H,11,18,23-27H2,1-10H3,(H,47,55)(H,48,53)(H,49,56)(H,50,54)/t30-,31-,34+,35-,36-,37-,38+,39+/m0/s1
InChI KeyKCYRWQKOIZHYNX-ARSHIWEASA-N