Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:51:10 UTC
Update Date2025-10-07 16:06:52 UTC
Metabolite IDMMDBc0018694
Metabolite Identification
Common NameRoquefortine F
DescriptionRoquefortine F is a secondary metabolite belonging to the class of alkaloids. It is produced by various species of fungi, including Penicillium, and is characterized by its complex chemical structure, which features a bicyclic system and multiple functional groups that contribute to its biological activity. The structural characterization of roquefortine F, along with neoxaline, was reported for the first time in the context of Penicillium species (PMID:24225953 ). Roquefortine F is involved in various biochemical pathways, including those related to fungal growth and development, where it may play a role in the regulation of metabolic processes. The compound's unique structure allows it to interact with cellular targets, potentially influencing signal transduction pathways and contributing to the organism's ecological interactions. Understanding the chemistry of roquefortine F enhances our knowledge of fungal metabolites and their roles in the environment, as well as their potential applications in biotechnology and pharmacology.
Structure
SynonymsNot Available
Molecular FormulaC23H25N5O3
Average Mass419.485
Monoisotopic Mass419.195739685
IUPAC Name(1R,4E,7S,9R)-6-hydroxy-4-[(1H-imidazol-5-yl)methylidene]-16-methoxy-9-(2-methylbut-3-en-2-yl)-2,5,16-triazatetracyclo[7.7.0.0^{2,7}.0^{10,15}]hexadeca-5,10,12,14-tetraen-3-one
Traditional Name(1R,4E,7S,9R)-6-hydroxy-4-(3H-imidazol-4-ylmethylidene)-16-methoxy-9-(2-methylbut-3-en-2-yl)-2,5,16-triazatetracyclo[7.7.0.0^{2,7}.0^{10,15}]hexadeca-5,10,12,14-tetraen-3-one
CAS Registry NumberNot Available
SMILES
[H]\C(C1=CN=CN1)=C1/N=C(O)[C@]2([H])C[C@]3(C4=CC=CC=C4N(OC)[C@@]3([H])N2C1=O)C(C)(C)C=C
InChI Identifier
InChI=1S/C23H25N5O3/c1-5-22(2,3)23-11-18-19(29)26-16(10-14-12-24-13-25-14)20(30)27(18)21(23)28(31-4)17-9-7-6-8-15(17)23/h5-10,12-13,18,21H,1,11H2,2-4H3,(H,24,25)(H,26,29)/b16-10+/t18-,21+,23+/m0/s1
InChI KeyUGXLTDJSORIITQ-QTJDKHMESA-N