Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:52:09 UTC
Update Date2025-10-07 16:06:52 UTC
Metabolite IDMMDBc0018712
Metabolite Identification
Common NameBacteriohopanetetrol carbapseudopentose ether
DescriptionBacteriohopanetetrol carbapseudopentose ether is a pentacyclic triterpenoid belonging to the class of hopanoids, which are structurally similar to sterols and play crucial roles in cellular membranes. Its chemical structure features a complex arrangement of cyclopentane and cyclohexane rings, with a hydroxyl group contributing to its hydrophilic properties. This compound is synthesized through the hopanoid biosynthetic pathway, which involves the enzymatic conversion of squalene and subsequent cyclization reactions. Notably, bacteriohopanetetrol carbapseudopentose ether has been identified in Burkholderia species and related soil isolates, where it serves as a primary hopanoid, indicating its potential role in membrane stabilization and cellular integrity under varying environmental conditions. The presence of this ether in certain bacterial strains, while absent in others such as Pseudomonas and Ralstonia, suggests a specific ecological adaptation or functional significance in those microorganisms. Additionally, the discovery of its Delta(6) unsaturated homologue indicates a diversity in hopanoid structures that may influence membrane properties and biological functions (PMID:10675600 ).
Structure
SynonymsNot Available
Molecular FormulaC41H73NO8
Average Mass708.034
Monoisotopic Mass707.533618315
IUPAC Name(1S,2S,3R,4R)-4-amino-5-{[(2S,3R,4R)-7-[(1R,2R,6R,9S,14S)-1,2,9,14,18,18-hexamethylpentacyclo[11.8.0.0^{2,10}.0^{5,9}.0^{14,19}]henicosan-6-yl]-2,3,4-trihydroxyoctyl]oxy}-1-(hydroxymethyl)cyclopentane-1,2,3-triol
Traditional Name(1S,2S,3R,4R)-4-amino-5-{[(2S,3R,4R)-7-[(1R,2R,6R,9S,14S)-1,2,9,14,18,18-hexamethylpentacyclo[11.8.0.0^{2,10}.0^{5,9}.0^{14,19}]henicosan-6-yl]-2,3,4-trihydroxyoctyl]oxy}-1-(hydroxymethyl)cyclopentane-1,2,3-triol
CAS Registry NumberNot Available
SMILES
[H]C(C)(CC[C@@]([H])(O)[C@@]([H])(O)[C@@]([H])(O)COC1([H])[C@]([H])(N)[C@@]([H])(O)[C@]([H])(O)[C@@]1(O)CO)[C@@]1([H])CC[C@@]2(C)C1([H])CC[C@]1(C)C2([H])CCC2([H])[C@@]3(C)CCCC(C)(C)C3([H])CC[C@@]12C
InChI Identifier
InChI=1S/C41H73NO8/c1-23(9-10-26(44)32(46)27(45)21-50-35-31(42)33(47)34(48)41(35,49)22-43)24-13-18-37(4)25(24)14-19-39(6)29(37)11-12-30-38(5)17-8-16-36(2,3)28(38)15-20-40(30,39)7/h23-35,43-49H,8-22,42H2,1-7H3/t23?,24-,25?,26-,27+,28?,29?,30?,31-,32-,33-,34+,35?,37+,38+,39-,40-,41+/m1/s1
InChI KeyAGAUYSZNDYQXOM-WHFOOSDBSA-N