Microbial
Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:52:24 UTC
Update Date2025-10-07 16:06:52 UTC
Metabolite IDMMDBc0018716
Metabolite Identification
Common NameEnterobactin
DescriptionEnterobactin is a high-affinity siderophore belonging to the chemical class of catecholates. Its chemical structure features a cyclic trimer of 2,3-dihydroxybenzoic acid units linked by peptide bonds, allowing it to effectively chelate iron ions, which is crucial for bacterial iron acquisition. Enterobactin is primarily produced by Escherichia coli and other enteric pathogens, playing a pivotal role in their virulence by sequestering iron from host environments, thus enabling bacterial survival even under iron-limited conditions typical of host tissues (PMID:40966180 ). The biosynthesis and regulation of enterobactin are intricately linked to bacterial pathogenesis and immune evasion, with implications for vaccine development and antimicrobial strategies (PMID:40966180 ). It has been identified as a virulence determinant alongside other factors such as fimbrial proteins and type VI secretion system proteins (PMID:41025610 ). Additionally, enterobactin's potential as a target for novel antimicrobial strategies is highlighted, including the development of small-molecule inhibitors and siderophore-based "Trojan horse" antibiotics (PMID:40966180 ). Overall, enterobactin serves as a critical component in various biological pathways related to iron acquisition and bacterial virulence (PMID:41000824 ).
Structure
SynonymsNot Available
Molecular FormulaC30H27N3O15
Average Mass669.552
Monoisotopic Mass669.144217181
IUPAC NameN-[7,11-bis(2,3-dihydroxybenzamido)-2,6,10-trioxo-1,5,9-trioxacyclododecan-3-yl]-2,3-dihydroxybenzamide
Traditional Nameenterobactin
CAS Registry NumberNot Available
SMILES
OC1=CC=CC(C(=O)NC2COC(=O)C(COC(=O)C(COC2=O)NC(=O)C2=CC=CC(O)=C2O)NC(=O)C2=CC=CC(O)=C2O)=C1O
InChI Identifier
InChI=1S/C30H27N3O15/c34-19-7-1-4-13(22(19)37)25(40)31-16-10-46-29(44)18(33-27(42)15-6-3-9-21(36)24(15)39)12-48-30(45)17(11-47-28(16)43)32-26(41)14-5-2-8-20(35)23(14)38/h1-9,16-18,34-39H,10-12H2,(H,31,40)(H,32,41)(H,33,42)
InChI KeySERBHKJMVBATSJ-UHFFFAOYSA-N