Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 08:54:33 UTC
Update Date2025-10-07 16:06:53 UTC
Metabolite IDMMDBc0018731
Metabolite Identification
Common NamePenicillenone
DescriptionPenicillenone is a polyketide, a class of natural products characterized by their complex structures derived from the polymerization of acyl-CoA precursors. Chemically, penicillenone features a distinctive carbon skeleton typical of polyketides, which includes multiple carbonyl and hydroxyl functional groups that contribute to its reactivity and biological activity. It is produced by the fungus Penicillium sp., where it is involved in various metabolic pathways, including the biosynthesis of other secondary metabolites. The presence of penicillenone and related compounds, such as leptosphaerone C and arugosin I, highlights the diverse chemical landscape of Penicillium species and their potential ecological roles. These metabolites may participate in interactions with other organisms or contribute to the organism's survival in competitive environments (PMID:18067932 ). The structural complexity of penicillenone and its derivatives makes them of interest for further research, particularly in understanding their biosynthetic pathways and potential applications in pharmaceuticals or agriculture.
Structure
SynonymsNot Available
Molecular FormulaC16H16O6
Average Mass304.298
Monoisotopic Mass304.094688235
IUPAC Name(2R,6Z)-2-hydroxy-6-[hydroxy(2-hydroxy-4-methoxyphenyl)methylidene]-2,5-dimethylcyclohex-4-ene-1,3-dione
Traditional Name(2R,6Z)-2-hydroxy-6-[hydroxy(2-hydroxy-4-methoxyphenyl)methylidene]-2,5-dimethylcyclohex-4-ene-1,3-dione
CAS Registry NumberNot Available
SMILES
COC1=CC(O)=C(C=C1)C(\O)=C1/C(C)=CC(=O)[C@@](C)(O)C1=O
InChI Identifier
InChI=1S/C16H16O6/c1-8-6-12(18)16(2,21)15(20)13(8)14(19)10-5-4-9(22-3)7-11(10)17/h4-7,17,19,21H,1-3H3/b14-13-/t16-/m1/s1
InChI KeyXHDBNNITLMCRAU-OMACXJQVSA-N