Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 09:05:30 UTC
Update Date2025-10-07 16:06:54 UTC
Metabolite IDMMDBc0018943
Metabolite Identification
Common NameMutanobactin A
DescriptionMutanobactin A is a hybrid polyketide-nonribosomal peptide metabolite produced by the bacterium Streptococcus mutans. Its chemical structure features a complex arrangement characteristic of secondary metabolites, which are often involved in interspecies interactions. Mutanobactin A plays a role in the fitness of S. mutans, as evidenced by its association with the gene SMU_833, highlighting its importance in bacterial survival (PMID:31554721 ). Furthermore, this compound functions as a cross-kingdom regulator, influencing the yeast-mycelium transition in the pathogenic fungus Candida albicans, demonstrating its broader biological implications beyond its bacterial origin (PMID:20852771 ). The generation of mutanobactin A is linked to specific gene clusters that facilitate its biosynthesis, underscoring its significance in microbial ecology and potential interactions within the human microbiome (PMID:22281750 ). Overall, mutanobactin A exemplifies the intricate chemistry of microbial metabolites and their potential roles in modulating interactions between different species.
Structure
SynonymsNot Available
Molecular FormulaC36H60N6O7S
Average Mass720.97
Monoisotopic Mass720.42441947
IUPAC Name(4S,7S,13R,16S)-19-decanoyl-3,6,15,18,23-pentahydroxy-13-methyl-16-(2-methylpropyl)-4-(propan-2-yl)-25-thia-2,5,11,14,17,22-hexaazatricyclo[18.3.2.0^{7,11}]pentacosa-2,5,14,17,22-pentaen-12-one
Traditional Name(4S,7S,13R,16S)-19-decanoyl-3,6,15,18,23-pentahydroxy-4-isopropyl-13-methyl-16-(2-methylpropyl)-25-thia-2,5,11,14,17,22-hexaazatricyclo[18.3.2.0^{7,11}]pentacosa-2,5,14,17,22-pentaen-12-one
CAS Registry NumberNot Available
SMILES
[H][C@@]12CCCN1C(=O)[C@@]([H])(C)N=C(O)[C@]([H])(CC(C)C)N=C(O)C([H])(C(=O)CCCCCCCCC)C1([H])CN=C(O)C([H])(CS1)N=C(O)[C@@]([H])(N=C2O)C(C)C
InChI Identifier
InChI=1S/C36H60N6O7S/c1-7-8-9-10-11-12-13-16-27(43)29-28-19-37-31(44)25(20-50-28)40-35(48)30(22(4)5)41-33(46)26-15-14-17-42(26)36(49)23(6)38-32(45)24(18-21(2)3)39-34(29)47/h21-26,28-30H,7-20H2,1-6H3,(H,37,44)(H,38,45)(H,39,47)(H,40,48)(H,41,46)/t23-,24+,25?,26+,28?,29?,30+/m1/s1
InChI KeyWDKYFUSPNIQGDO-IBCSGKGJSA-N