Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 09:10:20 UTC
Update Date2025-10-07 16:06:55 UTC
Metabolite IDMMDBc0019049
Metabolite Identification
Common NameBrevicompanine B
DescriptionBrevicompanine B is a diketopiperazine alkaloid, a chemical class characterized by a cyclic structure formed from two amino acids. Its synthesis involves a diastereoselective reverse prenylation of tryptophan methyl ester, showcasing its complex chemical pathways (PMID:25365411 ). The total synthesis of brevicompanine B has been achieved through innovative methodologies, including iridium-catalyzed reactions, which highlight its intricate chemical structure and potential synthetic utility (PMID:25365411 ). Additionally, brevicompanine B is part of a broader family of alkaloids, as evidenced by the isolation of related compounds from the marine-derived fungus Penicillium sp., including allo-brevicompanine B and fructigenine B (PMID:19652417 ). These compounds are known to exhibit various biological activities, although the specific biological significance of brevicompanine B remains to be fully elucidated. The pathways in which it is involved may include interactions with cellular signaling mechanisms, given the general properties of diketopiperazine alkaloids. Overall, brevicompanine B represents a fascinating subject for further research within the field of natural product chemistry.
Structure
SynonymsNot Available
Molecular FormulaC22H29N3O2
Average Mass367.493
Monoisotopic Mass367.225977186
IUPAC Name(1S,4R,7S,9R)-6-hydroxy-9-(2-methylbut-3-en-2-yl)-4-(2-methylpropyl)-2,5,16-triazatetracyclo[7.7.0.0^{2,7}.0^{10,15}]hexadeca-5,10,12,14-tetraen-3-one
Traditional Name(1S,4R,7S,9R)-6-hydroxy-9-(2-methylbut-3-en-2-yl)-4-(2-methylpropyl)-2,5,16-triazatetracyclo[7.7.0.0^{2,7}.0^{10,15}]hexadeca-5,10,12,14-tetraen-3-one
CAS Registry NumberNot Available
SMILES
[H][C@@]12C[C@]3(C4=CC=CC=C4N[C@@]3([H])N1C(=O)[C@@]([H])(CC(C)C)N=C2O)C(C)(C)C=C
InChI Identifier
InChI=1S/C22H29N3O2/c1-6-21(4,5)22-12-17-18(26)23-16(11-13(2)3)19(27)25(17)20(22)24-15-10-8-7-9-14(15)22/h6-10,13,16-17,20,24H,1,11-12H2,2-5H3,(H,23,26)/t16-,17+,20+,22-/m1/s1
InChI KeyHAXPBJUEOMQIJN-HBCLNWRISA-N