Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 09:19:43 UTC
Update Date2025-10-07 16:06:56 UTC
Metabolite IDMMDBc0019234
Metabolite Identification
Common NameSyringolin B
DescriptionSyringolin B is a macrolactam compound belonging to the class of proteasome inhibitors. Its chemical structure features a complex arrangement of cyclic and linear components that contribute to its interaction with the proteasome, a crucial cellular machinery for protein degradation. Research has demonstrated that syringolin B serves as a scaffold for the development of selective or dual proteasome subunit inhibitors, with structure-activity relationship studies revealing that modifications at the 3-position of its macrolactam moiety can enhance subunit selectivity (PMID:38704960 ). The substrate mimicry model for syringolins has been validated, as certain analogs exhibit significantly higher inhibitory activity against the proteasome compared to the methyl ester of syringolin B (PMID:26296913 ). The total syntheses of syringolin B and related syrbactin molecules have facilitated the creation of hybrid derivatives, further expanding the chemical diversity of this class (PMID:22870914 ). Additionally, the genetic engineering and heterologous expression of the syringolin biosynthetic gene cluster from Pseudomonas syringae have provided insights into the enzymatic processes involved in its biosynthesis (PMID:22851214 ). Overall, syringolin B is a key compound in the study of proteasome inhibition and secondary metabolite biosynthesis.
Structure
Synonyms
ValueSource
2-{[(1-{[(3Z)-2,7-dihydroxy-5-(propan-2-yl)-1,6-diazacyclododeca-1,3,6-trien-8-yl]-C-hydroxycarbonimidoyl}-2-methylpropyl)-C-hydroxycarbonimidoyl]amino}-3-methylbutanoateGenerator
Molecular FormulaC24H41N5O6
Average Mass495.621
Monoisotopic Mass495.30568406
IUPAC Name2-{[(1-{[(3Z)-2,7-dihydroxy-5-(propan-2-yl)-1,6-diazacyclododeca-1,3,6-trien-8-yl]-C-hydroxycarbonimidoyl}-2-methylpropyl)-C-hydroxycarbonimidoyl]amino}-3-methylbutanoic acid
Traditional Name2-{[(1-{[(3Z)-2,7-dihydroxy-5-isopropyl-1,6-diazacyclododeca-1,3,6-trien-8-yl]-C-hydroxycarbonimidoyl}-2-methylpropyl)-C-hydroxycarbonimidoyl]amino}-3-methylbutanoic acid
CAS Registry NumberNot Available
SMILES
[H]\C1=C([H])\C(O)=NCCCCC(N=C(O)C(N=C(O)NC(C(C)C)C(O)=O)C(C)C)C(O)=NC1C(C)C
InChI Identifier
InChI=1S/C24H41N5O6/c1-13(2)16-10-11-18(30)25-12-8-7-9-17(21(31)26-16)27-22(32)19(14(3)4)28-24(35)29-20(15(5)6)23(33)34/h10-11,13-17,19-20H,7-9,12H2,1-6H3,(H,25,30)(H,26,31)(H,27,32)(H,33,34)(H2,28,29,35)/b11-10-
InChI KeyAIMDTYKFJMYVNG-KHPPLWFESA-N