Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 09:21:12 UTC
Update Date2025-10-07 16:06:56 UTC
Metabolite IDMMDBc0019264
Metabolite Identification
Common NameNeomarinone
DescriptionNeomarinone is a meroterpenoid, a chemical class that encompasses compounds derived from both terpenes and non-terpene precursors. Its chemical structure features a complex arrangement of cyclic and acyclic components, indicative of its marine origin and biosynthetic pathways. Neomarinone has been isolated from the marine actinomycete Streptomyces aculeoletus, where it was identified alongside the novel metabolite madeirone, showcasing its potential as an antibiofilm and antifouling agent (PMID:39119516 ). The extraction process involved silica flash chromatography and preparative HPLC, leading to the isolation of neomarinone and its characterization (PMID:39119516 ). In addition to its structural elucidation, neomarinone has demonstrated significant biological activity, exhibiting up to 41% inhibition of biofilm formation against Pseudomonas species (PMID:39119516 ). The total synthesis of neomarinone has been achieved, confirming its stereochemistry and providing insights into its synthetic pathways (PMID:19053110 ). Furthermore, preliminary investigations into its biosynthesis suggest a complex metabolic route, reflecting its unique status as a rare marine-derived compound (PMID:15726291 ). Overall, neomarinone represents a fascinating subject of study within marine natural products chemistry.
Structure
Synonyms
ValueSource
(2R)-2a,3a,8-Trimethyl-3-[3-(1,2-dimethylcyclopentyl)-2-butenyl]-4,7-dihydroxy-2,3,6,9-tetrahydronaphtho[1,2-b]furan-6,9-dioneGenerator
(2R)-2Α,3α,8-trimethyl-3-[3-(1,2-dimethylcyclopentyl)-2-butenyl]-4,7-dihydroxy-2,3,6,9-tetrahydronaphtho[1,2-b]furan-6,9-dioneGenerator
Molecular FormulaC26H32O5
Average Mass424.537
Monoisotopic Mass424.22497413
IUPAC Name(2R,3S)-3-[(2Z)-3-(1,2-dimethylcyclopentyl)but-2-en-1-yl]-4,9-dihydroxy-2,3,8-trimethyl-2H,3H,6H,7H-naphtho[1,2-b]furan-6,7-dione
Traditional Name(2R,3S)-3-[(2Z)-3-(1,2-dimethylcyclopentyl)but-2-en-1-yl]-4,9-dihydroxy-2,3,8-trimethyl-2H-naphtho[1,2-b]furan-6,7-dione
CAS Registry NumberNot Available
SMILES
[H]\C(C[C@@]1(C)C2=C(O)C=C3C(=O)C(=O)C(C)=C(O)C3=C2O[C@]1([H])C)=C(/C)C1(C)CCCC1([H])C
InChI Identifier
InChI=1S/C26H32O5/c1-13-8-7-10-25(13,5)14(2)9-11-26(6)16(4)31-24-19-17(12-18(27)20(24)26)23(30)22(29)15(3)21(19)28/h9,12-13,16,27-28H,7-8,10-11H2,1-6H3/b14-9-/t13?,16-,25?,26-/m1/s1
InChI KeyGLYMAVAIGBFVIQ-JWKJSACTSA-N