Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 09:25:06 UTC
Update Date2025-10-07 16:06:57 UTC
Metabolite IDMMDBc0019322
Metabolite Identification
Common NameDihydrobotrydial
DescriptionDihydrobotrydial is a secondary metabolite belonging to the class of botryane ethers. Its chemical structure features a complex arrangement of carbon atoms, including multiple hydroxyl groups, which contribute to its biological activity. Dihydrobotrydial is primarily produced by certain fungi, such as those in the genus Hypocrea and Hymenoscyphus, and is associated with the production of phytotoxic metabolites like botrydial. The pathways involved in its biosynthesis include intricate enzymatic reactions that lead to the formation of these toxic compounds, which have been shown to affect spore viability and plant health. For instance, studies have demonstrated that the concentration of dihydrobotrydial can be influenced by external factors such as curcumin levels, which reduce its production alongside that of botrydial (PMID:33803254 ). Analytical techniques like thin-layer chromatography and mass spectrometry have been employed to evaluate its production (PMID:29147762 ). Additionally, its structure has been characterized using various spectroscopic methods (PMID:19160818 ). Dihydrobotrydial's potential applications in pharmacology, particularly in antiplasmodial and cytotoxicity testing, highlight its relevance in natural product research (PMID:9309875 ).
Structure
SynonymsNot Available
Molecular FormulaC17H28O5
Average Mass312.406
Monoisotopic Mass312.193674002
IUPAC Name(1R,4R,7S,8S,9R,11S,12S)-7,12-dihydroxy-2,2,4,9-tetramethyl-6-oxatricyclo[6.3.1.0^{4,12}]dodecan-11-yl acetate
Traditional Name(1R,4R,7S,8S,9R,11S,12S)-7,12-dihydroxy-2,2,4,9-tetramethyl-6-oxatricyclo[6.3.1.0^{4,12}]dodecan-11-yl acetate
CAS Registry NumberNot Available
SMILES
[H][C@]12[C@]([H])(C[C@@]([H])(C)[C@]3([H])[C@@]([H])(O)OC[C@@](C)(CC1(C)C)[C@]23O)OC(C)=O
InChI Identifier
InChI=1S/C17H28O5/c1-9-6-11(22-10(2)18)13-15(3,4)7-16(5)8-21-14(19)12(9)17(13,16)20/h9,11-14,19-20H,6-8H2,1-5H3/t9-,11+,12-,13+,14+,16-,17-/m1/s1
InChI KeyQUGYVDURDBEQRB-CJNHKLDISA-N