Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 09:25:15 UTC
Update Date2025-10-07 16:06:57 UTC
Metabolite IDMMDBc0019325
Metabolite Identification
Common NamePenostatin E
DescriptionPenostatin E is a polyketide, a class of natural products characterized by their complex structures and diverse biological activities. Its chemical structure features a unique arrangement of carbon chains and functional groups that contribute to its reactivity and potential interactions within biological pathways. The enantioselective total synthesis of penostatin E has been achieved, showcasing a late-stage introduction of the side chain through a base-promoted elimination reaction, which highlights the compound's intricate synthetic accessibility (PMID:25075759 ). While the specific biological significance of penostatin E remains to be fully elucidated, compounds in the polyketide class are often involved in various cellular processes, including modulation of signaling pathways and interactions with enzymes or receptors. This positions penostatin E as a compound of interest for further exploration in medicinal chemistry and pharmacology, potentially leading to insights into its biological roles and therapeutic applications.
Structure
SynonymsNot Available
Molecular FormulaC22H32O3
Average Mass344.495
Monoisotopic Mass344.23514489
IUPAC Name6-hydroxy-7-[(1Z,3E)-5-hydroxy-2-methyldodeca-1,3-dien-1-yl]-5,6,7,7a-tetrahydro-1H-inden-5-one
Traditional Name6-hydroxy-7-[(1Z,3E)-5-hydroxy-2-methyldodeca-1,3-dien-1-yl]-1,6,7,7a-tetrahydroinden-5-one
CAS Registry NumberNot Available
SMILES
[H]C(C(O)CCCCCCC)=C([H])C(\C)=C(\[H])C1C2CC=CC2=CC(=O)C1O
InChI Identifier
InChI=1S/C22H32O3/c1-3-4-5-6-7-10-18(23)13-12-16(2)14-20-19-11-8-9-17(19)15-21(24)22(20)25/h8-9,12-15,18-20,22-23,25H,3-7,10-11H2,1-2H3/b13-12+,16-14-
InChI KeyCOBSXLQCUDCOES-LIACPWMRSA-N