Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 09:32:56 UTC
Update Date2025-10-07 16:06:58 UTC
Metabolite IDMMDBc0019498
Metabolite Identification
Common NameAndrastin D
DescriptionAndrastin D is a member of the chemical class of natural products known as farnesyltransferase inhibitors, specifically derived from the genus Penicillium. Its chemical structure features a bicyclo[3.3.1]nonane core, which is characteristic of the andrastin family, formed through a radical-based, abiotic rearrangement process that allows for isomerization into various fused ring systems (PMID:33448794 ). This unique arrangement contributes to its biological activity, particularly its role as a protein farnesyltransferase inhibitor, which is significant in cellular signaling pathways involving protein modification and membrane localization (PMID:9031675 ). Additionally, Andrastin D is associated with the production of mycotoxins and certain phenol-derived compounds, which further highlights its complex biochemical interactions and potential implications in the ecology of the producing organism, as well as its chemotaxonomic distinction within its fungal section (PMID:33448794 ). Overall, Andrastin D exemplifies the intricate relationship between chemical structure and biological function in natural products.
Structure
SynonymsNot Available
Molecular FormulaC26H36O5
Average Mass428.569
Monoisotopic Mass428.256274259
IUPAC Namemethyl (1S,2R,7S,10S,11R,15R)-14-hydroxy-2,6,6,10,13,15,16-heptamethyl-5,12-dioxotetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadeca-13,16-diene-11-carboxylate
Traditional Namemethyl (1S,2R,7S,10S,11R,15R)-14-hydroxy-2,6,6,10,13,15,16-heptamethyl-5,12-dioxotetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadeca-13,16-diene-11-carboxylate
CAS Registry NumberNot Available
SMILES
[H][C@]12CC[C@@]3(C)[C@@]([H])(C=C(C)[C@@]4(C)C(O)=C(C)C(=O)[C@@]34C(=O)OC)[C@]1(C)CCC(=O)C2(C)C
InChI Identifier
InChI=1S/C26H36O5/c1-14-13-17-23(5)11-10-18(27)22(3,4)16(23)9-12-24(17,6)26(21(30)31-8)20(29)15(2)19(28)25(14,26)7/h13,16-17,28H,9-12H2,1-8H3/t16-,17+,23-,24+,25+,26-/m1/s1
InChI KeySMUNNMAWNRFDPB-UWWAQUNASA-N