Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 09:35:16 UTC
Update Date2025-10-07 16:06:58 UTC
Metabolite IDMMDBc0019521
Metabolite Identification
Common NameIsochromophilone IX
DescriptionIsochromophilone IX is a chlorinated azaphilone alkaloid, classified within the broader chemical class of isochromophilones. This compound was isolated from the fermentation products of ACD-5 in brown rice medium, alongside other related metabolites, through bioactivity-guided methods and mass spectrometry analysis (PMID:37206330 ). The chemical structure of isochromophilone IX features a complex arrangement of aromatic rings and halogen substituents, which contribute to its unique properties and potential bioactivities. In terms of biological pathways, isochromophilone IX may be involved in various metabolic processes, particularly those related to secondary metabolite production in fungi and plants, although specific pathways remain to be fully elucidated. Its structural characteristics and biosynthetic origins suggest it could play roles in ecological interactions, such as defense mechanisms against pathogens or competitors, reflecting the diverse functions of secondary metabolites in nature.
Structure
SynonymsNot Available
Molecular FormulaC25H30ClNO6
Average Mass475.97
Monoisotopic Mass475.1761654
IUPAC Name4-[(7R)-7-(acetyloxy)-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dien-1-yl]-7-methyl-6,8-dioxo-2,6,7,8-tetrahydroisoquinolin-2-yl]butanoic acid
Traditional Name4-[(7R)-7-(acetyloxy)-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dien-1-yl]-7-methyl-6,8-dioxoisoquinolin-2-yl]butanoic acid
CAS Registry NumberNot Available
SMILES
[H]\C(=C(\[H])C1=CC2=C(Cl)C(=O)[C@](C)(OC(C)=O)C(=O)C2=CN1CCCC(O)=O)\C(\C)=C(/[H])[C@@]([H])(C)CC
InChI Identifier
InChI=1S/C25H30ClNO6/c1-6-15(2)12-16(3)9-10-18-13-19-20(14-27(18)11-7-8-21(29)30)23(31)25(5,33-17(4)28)24(32)22(19)26/h9-10,12-15H,6-8,11H2,1-5H3,(H,29,30)/b10-9+,16-12+/t15-,25+/m0/s1
InChI KeySAMXBYLRDCRTCV-ZPVXUDNESA-N