Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 09:36:01 UTC
Update Date2025-10-07 16:06:58 UTC
Metabolite IDMMDBc0019538
Metabolite Identification
Common NameEremoxylarin A
DescriptionEremoxylarin A is a sesquiterpene belonging to the eremophilane chemical class. This compound features a complex bicyclic structure characterized by a fused ring system, which contributes to its biological activity. Eremoxylarin A has been shown to exhibit significant antimicrobial properties, particularly against gram-positive bacteria, including methicillin-resistant Staphylococcus aureus (MRSA) and vancomycin-resistant Leuconostoc mesenteroides VKPM B-4177 (PMID:27141643 ). Its efficacy has been evaluated in a murine model of staphylococcal sepsis, highlighting its potential therapeutic applications (PMID:27141643 ). The unique chemical structure of eremoxylarin A allows for modifications that could lead to the development of less toxic derivatives while preserving its valuable antimicrobial properties (PMID:27141643 ). The pathways involved in its action may include disruption of bacterial cell wall synthesis and interference with essential metabolic processes, making it a promising candidate for further research in antibiotic development.
Structure
SynonymsNot Available
Molecular FormulaC28H38O6
Average Mass470.606
Monoisotopic Mass470.266838944
IUPAC Name(1S,4R,7R,8aR)-8a-methyl-6-oxo-7-(3-oxoprop-1-en-2-yl)-4-{[(2E,4E)-4,6,8-trimethyldeca-2,4-dienoyl]oxy}-1,2,3,4,6,7,8,8a-octahydronaphthalene-1-carboxylic acid
Traditional Name(1S,4R,7R,8aR)-8a-methyl-6-oxo-7-(3-oxoprop-1-en-2-yl)-4-{[(2E,4E)-4,6,8-trimethyldeca-2,4-dienoyl]oxy}-1,2,3,4,7,8-hexahydronaphthalene-1-carboxylic acid
CAS Registry NumberNot Available
SMILES
[H]\C(=C(\[H])/C(/C)=C(\[H])C([H])(C)CC([H])(C)CC)C(=O)O[C@]1([H])CC[C@]([H])(C(O)=O)[C@@]2(C)C[C@]([H])(C(=C)C=O)C(=O)C=C12
InChI Identifier
InChI=1S/C28H38O6/c1-7-17(2)12-19(4)13-18(3)8-11-26(31)34-25-10-9-22(27(32)33)28(6)15-21(20(5)16-29)24(30)14-23(25)28/h8,11,13-14,16-17,19,21-22,25H,5,7,9-10,12,15H2,1-4,6H3,(H,32,33)/b11-8+,18-13+/t17?,19?,21-,22-,25-,28-/m1/s1
InChI KeyJNXDHAJFIDNOLG-SRZGMPGVSA-N