Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 09:37:12 UTC
Update Date2025-10-07 16:06:59 UTC
Metabolite IDMMDBc0019562
Metabolite Identification
Common NameIsoterrein
DescriptionIsoterrein is a 3-substituted δ-lactone belonging to the chemical class of lactones, specifically identified as a metabolite derived from the fungal species Aspergillus terreus. Its chemical structure features a lactone ring, which is a cyclic ester formed from the reaction of a hydroxyl group and a carboxylic acid. Isoterrein is involved in the biosynthetic pathways leading to the production of terreinlactone A and B, which are enantiomers and biosynthetic intermediates, respectively. These compounds are synthesized from their precursor (+)-terrein, showcasing isoterrein's role in the complex metabolic processes of A. terreus. The isolation of these metabolites highlights the intricate biochemical pathways that fungi utilize to generate diverse secondary metabolites, contributing to their ecological interactions and potential applications in biotechnology. (PMID:29657234 )
Structure
SynonymsNot Available
Molecular FormulaC8H10O3
Average Mass154.165
Monoisotopic Mass154.062994182
IUPAC Name(4S,5S)-4,5-dihydroxy-3-[(1E)-prop-1-en-1-yl]cyclopent-2-en-1-one
Traditional Name(4S,5S)-4,5-dihydroxy-3-[(1E)-prop-1-en-1-yl]cyclopent-2-en-1-one
CAS Registry NumberNot Available
SMILES
[H]\C(C)=C(\[H])C1=CC(=O)[C@@]([H])(O)[C@@]1([H])O
InChI Identifier
InChI=1S/C8H10O3/c1-2-3-5-4-6(9)8(11)7(5)10/h2-4,7-8,10-11H,1H3/b3-2+/t7-,8+/m0/s1
InChI KeyMHOOPNKRBMHHEC-RIAPOHOLSA-N